![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| OST Cry of fear ó Brandon.mp3 | 2025-12-28 03:14 | 12M | |
| Muddasheep ó One Way or Another.mp3 | 2025-12-28 03:14 | 7.3M | |
| Muddasheep ó Chainsaw Reaction.mp3 | 2025-12-28 03:14 | 7.1M | |
| Cry of Fear OST ó One Way or Another.mp3 | 2025-12-28 03:14 | 9.1M | |
| Cry of Fear ñ Lonely.mp3 | 2025-12-28 03:14 | 5.7M | |
| Cry of Fear ñ Anxiety.mp3 | 2025-12-28 03:14 | 4.7M | |
| Andreas Rˆnnberg ó Sophie.mp3 | 2025-12-28 03:14 | 6.2M | |
| Andreas Rˆnnberg ó Betrayal.mp3 | 2025-12-28 03:14 | 8.7M | |
| Andreas Rˆnnberg ñ Crow.mp3 | 2025-12-28 03:14 | 3.5M | |