![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/compressed.gif) | WWF WrestleMania - The Arcade Game (USA, Europe) (Beta).zip | 2026-01-02 14:42 | 146K | |
![[ ]](/icons/compressed.gif) | WWF Super WrestleMania (USA, Europe).zip | 2026-01-02 14:42 | 615K | |
![[ ]](/icons/compressed.gif) | WWF Royal Rumble (World).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | WWF Raw (World).zip | 2026-01-02 14:42 | 2.1M | |
![[ ]](/icons/compressed.gif) | Wrestle War (W).zip | 2026-01-02 14:42 | 399K | |
![[ ]](/icons/compressed.gif) | Worms (USA) (Beta) (June, 1995).zip | 2026-01-02 14:42 | 670K | |
![[ ]](/icons/compressed.gif) | Worms (U).zip | 2026-01-02 14:42 | 827K | |
![[ ]](/icons/compressed.gif) | World Trophy Soccer (USA).zip | 2026-01-02 14:42 | 228K | |
![[ ]](/icons/compressed.gif) | World Series Baseball 98 (USA).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '96 (USA).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-14).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-13).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-12).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-11).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-09).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-09) (Alt 1).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-07).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-03).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-02-02).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-30).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-25).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-20).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-18).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-16).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-14).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-10).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-09).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-05).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-03).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1995-01-01).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1994-12-28).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1994-12-14).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | World Series Baseball '95 (USA) (Beta) (1994-12-08).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Rev A) (Beta) (1994-05-27).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1994-03-04).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1994-02-18).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1994-01-16).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1994-01-06).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1994-01-03).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1993-12-29).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1993-12-26).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1993-12-22).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | World Series Baseball (USA) (Beta) (1993-10-01).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | World of Illusion Starring Mickey Mouse and Donald Duck (USA, Korea).zip | 2026-01-02 14:42 | 755K | |
![[ ]](/icons/compressed.gif) | World of Illusion starring Mickey Mouse & Donald Duck (USA, Korea) (Beta 2).zip | 2026-01-02 14:42 | 676K | |
![[ ]](/icons/compressed.gif) | World of Illusion starring Mickey Mouse & Donald Duck (USA, Korea) (Beta 1).zip | 2026-01-02 14:42 | 680K | |
![[ ]](/icons/compressed.gif) | World Heroes (USA).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-31).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-31) (Alt 1).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-30).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-24).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-23).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-22).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-18).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-16).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-15).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-09).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-07).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-03-03).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Heroes (USA) (Beta) (1994-02-23).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | World Cup USA 94 (USA, Europe, Korea) (En,Fr,De,Es,It,Nl,Pt,Sv).zip | 2026-01-02 14:42 | 420K | |
![[ ]](/icons/compressed.gif) | World Cup Soccer ~ World Championship Soccer (Japan, USA).zip | 2026-01-02 14:42 | 156K | |
![[ ]](/icons/compressed.gif) | World Cup Soccer ~ World Championship Soccer (Japan, USA) (Rev B).zip | 2026-01-02 14:42 | 157K | |
![[ ]](/icons/compressed.gif) | World Cup Soccer ~ World Championship Soccer (Japan, USA) (Rev A).zip | 2026-01-02 14:42 | 155K | |
![[ ]](/icons/compressed.gif) | World Class Leaderboard Golf (USA).zip | 2026-01-02 14:42 | 265K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA).zip | 2026-01-02 14:42 | 487K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (January, 1994).zip | 2026-01-02 14:42 | 314K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-30).zip | 2026-01-02 14:42 | 488K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-29).zip | 2026-01-02 14:42 | 488K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-29) (Alt 1).zip | 2026-01-02 14:42 | 488K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-27).zip | 2026-01-02 14:42 | 492K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-26).zip | 2026-01-02 14:42 | 492K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-25).zip | 2026-01-02 14:42 | 486K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-24).zip | 2026-01-02 14:42 | 463K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-23).zip | 2026-01-02 14:42 | 463K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-18).zip | 2026-01-02 14:42 | 460K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-14).zip | 2026-01-02 14:42 | 416K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-09).zip | 2026-01-02 14:42 | 344K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-09) (Alt 1).zip | 2026-01-02 14:42 | 344K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-04).zip | 2026-01-02 14:42 | 351K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-03).zip | 2026-01-02 14:42 | 350K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-03-03) (Alt 1).zip | 2026-01-02 14:42 | 332K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-02-28).zip | 2026-01-02 14:42 | 326K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-02-23).zip | 2026-01-02 14:42 | 324K | |
![[ ]](/icons/compressed.gif) | World Championship Soccer II (USA) (Beta) (1994-02-22).zip | 2026-01-02 14:42 | 324K | |
![[ ]](/icons/compressed.gif) | Wonder Boy in Monster World (USA, Europe).zip | 2026-01-02 14:42 | 517K | |
![[ ]](/icons/compressed.gif) | Wonder Boy III - Monster Lair (U) [c][!].zip | 2026-01-02 14:42 | 216K | |
![[ ]](/icons/compressed.gif) | Wolverine - Adamantium Rage (USA, Europe).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Wolfchild (USA).zip | 2026-01-02 14:42 | 353K | |
![[ ]](/icons/compressed.gif) | Wiz 'N' Liz (USA).zip | 2026-01-02 14:42 | 672K | |
![[ ]](/icons/compressed.gif) | Winter Olympic Games (USA) (En,Fr,De,Es,It,Pt,Sv,No).zip | 2026-01-02 14:42 | 772K | |
![[ ]](/icons/compressed.gif) | Winter Challenge (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 452K | |
![[ ]](/icons/compressed.gif) | Winter Challenge (USA, Europe) (Rev 1).zip | 2026-01-02 14:42 | 451K | |
![[ ]](/icons/compressed.gif) | Wings of Wor (USA).zip | 2026-01-02 14:42 | 281K | |
![[ ]](/icons/compressed.gif) | Wimbledon Championship Tennis (USA).zip | 2026-01-02 14:42 | 513K | |
![[ ]](/icons/compressed.gif) | Wimbledon Championship Tennis (USA) (Beta).zip | 2026-01-02 14:42 | 514K | |
![[ ]](/icons/compressed.gif) | Williams Arcade's Greatest Hits (USA).zip | 2026-01-02 14:42 | 266K | |
![[ ]](/icons/compressed.gif) | Wild Snake (USA) (Proto).zip | 2026-01-02 14:42 | 175K | |
![[ ]](/icons/compressed.gif) | Whip Rush (USA).zip | 2026-01-02 14:42 | 212K | |
![[ ]](/icons/compressed.gif) | Whip Rush (USA) (Beta) (1990-01-29).zip | 2026-01-02 14:42 | 211K | |
![[ ]](/icons/compressed.gif) | Where in Time Is Carmen Sandiego (USA, Europe) (En,Fr,De,Es,It).zip | 2026-01-02 14:42 | 704K | |
![[ ]](/icons/compressed.gif) | Where in the World Is Carmen Sandiego (USA, Europe) (En,Fr,De,Es,It).zip | 2026-01-02 14:42 | 713K | |
![[ ]](/icons/compressed.gif) | Where in the World Is Carmen Sandiego (Brazil) (Es,Pt).zip | 2026-01-02 14:42 | 720K | |
![[ ]](/icons/compressed.gif) | Wheel of Fortune (USA).zip | 2026-01-02 14:42 | 272K | |
![[ ]](/icons/compressed.gif) | WeaponLord (USA).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Wayne's World (USA).zip | 2026-01-02 14:42 | 658K | |
![[ ]](/icons/compressed.gif) | Wayne Gretzky and the NHLPA All-Stars (USA, Europe).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Water Margin - The Tales of Clouds and Winds (USA) (Unl).zip | 2026-01-02 14:42 | 903K | |
![[ ]](/icons/compressed.gif) | Warsong (USA).zip | 2026-01-02 14:42 | 283K | |
![[ ]](/icons/compressed.gif) | Warsong (USA) (Beta) (1991-10-01).zip | 2026-01-02 14:42 | 283K | |
![[ ]](/icons/compressed.gif) | Warrior of Rome II (USA).zip | 2026-01-02 14:42 | 357K | |
![[ ]](/icons/compressed.gif) | Warrior of Rome (USA).zip | 2026-01-02 14:42 | 335K | |
![[ ]](/icons/compressed.gif) | WarpSpeed (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 751K | |
![[ ]](/icons/compressed.gif) | Warlock (USA, Europe).zip | 2026-01-02 14:42 | 962K | |
![[ ]](/icons/compressed.gif) | Warlock (USA, Europe) (Beta) (December, 1994).zip | 2026-01-02 14:42 | 962K | |
![[ ]](/icons/compressed.gif) | Wardner (USA).zip | 2026-01-02 14:42 | 223K | |
![[ ]](/icons/compressed.gif) | Wacky Worlds Creativity Studio (USA).zip | 2026-01-02 14:42 | 401K | |
![[ ]](/icons/compressed.gif) | Wacky Worlds Creativity Studio (USA) (Beta) (1994-08-19).zip | 2026-01-02 14:42 | 389K | |
![[ ]](/icons/compressed.gif) | Wacky Worlds Creativity Studio (USA) (Beta) (1994-08-17).zip | 2026-01-02 14:42 | 387K | |
![[ ]](/icons/compressed.gif) | Wacky Worlds Creativity Studio (USA) (Beta) (1994-08-08).zip | 2026-01-02 14:42 | 380K | |
![[ ]](/icons/compressed.gif) | Wacky Races (USA) (Proto).zip | 2026-01-02 14:42 | 952K | |
![[ ]](/icons/compressed.gif) | VR Troopers (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Virtual Pinball (USA, Europe).zip | 2026-01-02 14:42 | 286K | |
![[ ]](/icons/compressed.gif) | Virtual Bart (World).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Virtua Racing (USA).zip | 2026-01-02 14:42 | 687K | |
![[ ]](/icons/compressed.gif) | Virtua Fighter 2 (USA, Europe).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Virtua Fighter 2 (USA, Europe) (Beta) (1996-09-27).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Virtua Fighter 2 (USA, Europe) (Beta) (1996-09-20).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Virtua Fighter 2 (USA, Europe) (Beta) (1996-09-13).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Virtua Fighter 2 (USA, Europe) (Beta) (1996-08-30).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Virtua Fighter 2 (USA, Europe) (Beta) (1996-08-19).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Viewpoint (USA).zip | 2026-01-02 14:42 | 598K | |
![[ ]](/icons/compressed.gif) | Viewpoint (USA) (Beta) (August, 1994).zip | 2026-01-02 14:42 | 556K | |
![[ ]](/icons/compressed.gif) | Viewpoint (USA) (Beta) (1994-07-22).zip | 2026-01-02 14:42 | 566K | |
![[ ]](/icons/compressed.gif) | Venom . Spider-Man - Separation Anxiety (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Sample) (1996-08-28).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Beta) (August, 1995).zip | 2026-01-02 14:42 | 665K | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Beta) (1996-08-27).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Beta) (1996-08-26).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Beta) (1996-08-19).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Beta) (1996-08-16).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Vectorman 2 (USA) (Beta) (1996-08-15).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Vectorman (USA, Europe).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Vectorman (USA, Europe) (Sega Smash Pack).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Vectorman (USA, Europe) (Beta 3) (1995-07-24).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Vectorman (USA, Europe) (Beta 2).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Vectorman (USA, Europe) (Beta 1).zip | 2026-01-02 14:42 | 880K | |
![[ ]](/icons/compressed.gif) | Vapor Trail (USA).zip | 2026-01-02 14:42 | 433K | |
![[ ]](/icons/compressed.gif) | Vapor Trail (USA) (Beta) (1991-05-26).zip | 2026-01-02 14:42 | 433K | |
![[ ]](/icons/compressed.gif) | Valis III (USA).zip | 2026-01-02 14:42 | 763K | |
![[ ]](/icons/compressed.gif) | Valis (USA).zip | 2026-01-02 14:42 | 733K | |
![[ ]](/icons/compressed.gif) | Valis (USA) (Beta) (1991-10-25).zip | 2026-01-02 14:42 | 733K | |
![[ ]](/icons/compressed.gif) | Urban Strike (USA, Europe).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Unnecessary Roughness '95 (USA).zip | 2026-01-02 14:42 | 749K | |
![[ ]](/icons/compressed.gif) | Universal Soldier (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 437K | |
![[ ]](/icons/compressed.gif) | Uncharted Waters (USA).zip | 2026-01-02 14:42 | 378K | |
![[ ]](/icons/compressed.gif) | Ultracore (USA).zip | 2026-01-02 14:42 | 689K | |
![[ ]](/icons/compressed.gif) | Ultimate Soccer (U).zip | 2026-01-02 14:42 | 317K | |
![[ ]](/icons/compressed.gif) | Ultimate QIX (USA).zip | 2026-01-02 14:42 | 135K | |
![[ ]](/icons/compressed.gif) | Ultimate Mortal Kombat 3 (USA).zip | 2026-01-02 14:42 | 3.2M | |
![[ ]](/icons/compressed.gif) | Tyrants - Fight through Time (USA).zip | 2026-01-02 14:42 | 540K | |
![[ ]](/icons/compressed.gif) | Two Tribes - Populous II (U).zip | 2026-01-02 14:42 | 462K | |
![[ ]](/icons/compressed.gif) | Two Crude Dudes (USA).zip | 2026-01-02 14:42 | 532K | |
![[ ]](/icons/compressed.gif) | Two Crude Dudes (USA) (Beta) (1991-11-24).zip | 2026-01-02 14:42 | 533K | |
![[ ]](/icons/compressed.gif) | Twisted Flipper (USA) (Beta).zip | 2026-01-02 14:42 | 184K | |
![[ ]](/icons/compressed.gif) | Twinkle Tale (JU).zip | 2026-01-02 14:42 | 535K | |
![[ ]](/icons/compressed.gif) | Twin Hawk (U) [!].zip | 2026-01-02 14:42 | 191K | |
![[ ]](/icons/compressed.gif) | Twin Cobra - Desert Attack Helicopter (USA).zip | 2026-01-02 14:42 | 345K | |
![[ ]](/icons/compressed.gif) | Turrican (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 293K | |
![[ ]](/icons/compressed.gif) | Turbo OutRun (W).zip | 2026-01-02 14:42 | 287K | |
![[ ]](/icons/compressed.gif) | True Lies (World).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Troy Aikman NFL Football (USA).zip | 2026-01-02 14:42 | 877K | |
![[ ]](/icons/compressed.gif) | Trouble Shooter (USA).zip | 2026-01-02 14:42 | 297K | |
![[ ]](/icons/compressed.gif) | Trouble Shooter (USA) (Beta) (1991-09-12).zip | 2026-01-02 14:42 | 298K | |
![[ ]](/icons/compressed.gif) | Triple Play 96 (USA).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Triple Play - Gold Edition (USA).zip | 2026-01-02 14:42 | 1.9M | |
![[ ]](/icons/compressed.gif) | Traysia (USA).zip | 2026-01-02 14:42 | 579K | |
![[ ]](/icons/compressed.gif) | Traysia (USA) (Beta) (1992-01-22).zip | 2026-01-02 14:42 | 579K | |
![[ ]](/icons/compressed.gif) | Trampoline Terror! (USA).zip | 2026-01-02 14:42 | 158K | |
![[ ]](/icons/compressed.gif) | Toys - Let the Toy Wars begin! (USA).zip | 2026-01-02 14:42 | 410K | |
![[ ]](/icons/compressed.gif) | Toy Story (USA).zip | 2026-01-02 14:42 | 2.6M | |
![[ ]](/icons/compressed.gif) | Toy Story (USA) (Sample).zip | 2026-01-02 14:42 | 2.3M | |
![[ ]](/icons/compressed.gif) | Toxic Crusaders (USA).zip | 2026-01-02 14:42 | 348K | |
![[ ]](/icons/compressed.gif) | Toughman Contest (USA, Europe).zip | 2026-01-02 14:42 | 2.7M | |
![[ ]](/icons/compressed.gif) | Total Football (U).zip | 2026-01-02 14:42 | 752K | |
![[ ]](/icons/compressed.gif) | Top Gear 2 (USA).zip | 2026-01-02 14:42 | 434K | |
![[ ]](/icons/compressed.gif) | Tony La Russa Baseball (USA, Australia).zip | 2026-01-02 14:42 | 466K | |
![[ ]](/icons/compressed.gif) | Tommy Lasorda Baseball (USA).zip | 2026-01-02 14:42 | 277K | |
![[ ]](/icons/compressed.gif) | Tommy Lasorda Baseball (USA) (Beta) (1989-04-30).zip | 2026-01-02 14:42 | 277K | |
![[ ]](/icons/compressed.gif) | Tom Mason's Dinosaurs for Hire (USA).zip | 2026-01-02 14:42 | 615K | |
![[ ]](/icons/compressed.gif) | Tom Mason's Dinosaurs for Hire (USA) (Beta) (March, 1993).zip | 2026-01-02 14:42 | 446K | |
![[ ]](/icons/compressed.gif) | Tom Mason's Dinosaurs for Hire (USA) (Beta) (1993-05-02).zip | 2026-01-02 14:42 | 617K | |
![[ ]](/icons/compressed.gif) | Tom Mason's Dinosaurs for Hire (USA) (Beta) (1993-04-27).zip | 2026-01-02 14:42 | 616K | |
![[ ]](/icons/compressed.gif) | Tom Mason's Dinosaurs for Hire (USA) (Beta) (1993-04-26).zip | 2026-01-02 14:42 | 615K | |
![[ ]](/icons/compressed.gif) | Tom and Jerry - Frantic Antics! (USA).zip | 2026-01-02 14:42 | 498K | |
![[ ]](/icons/compressed.gif) | Tom and Jerry - Frantic Antics! (USA) (Beta).zip | 2026-01-02 14:42 | 496K | |
![[ ]](/icons/compressed.gif) | Toki - Going Ape Spit (USA, Europe).zip | 2026-01-02 14:42 | 274K | |
![[ ]](/icons/compressed.gif) | ToeJam & Earl in Panic on Funkotron (USA).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | ToeJam & Earl in Panic on Funkotron (USA) (Beta) (August, 1993).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | ToeJam & Earl in Panic on Funkotron (USA) (1993-09-11) (Sega Channel).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | ToeJam & Earl (USA, Europe, Korea).zip | 2026-01-02 14:42 | 604K | |
![[ ]](/icons/compressed.gif) | Todd's Adventures in Slime World (USA).zip | 2026-01-02 14:42 | 214K | |
![[ ]](/icons/compressed.gif) | TNN Outdoors Bass Tournament '96 (USA).zip | 2026-01-02 14:42 | 547K | |
![[ ]](/icons/compressed.gif) | TNN Bass Tournament of Champions (USA).zip | 2026-01-02 14:42 | 723K | |
![[ ]](/icons/compressed.gif) | Tiny Toon Adventures - Buster's Hidden Treasure (USA).zip | 2026-01-02 14:42 | 358K | |
![[ ]](/icons/compressed.gif) | Tiny Toon Adventures - ACME All-Stars (USA, Korea).zip | 2026-01-02 14:42 | 565K | |
![[ ]](/icons/compressed.gif) | Tintin in Tibet (U) (M6).zip | 2026-01-02 14:42 | 856K | |
![[ ]](/icons/compressed.gif) | Tinhead (USA) (Spectrum HoloByte) (October, 1995).zip | 2026-01-02 14:42 | 478K | |
![[ ]](/icons/compressed.gif) | Tinhead (USA) (Ballistic) (April, 1994).zip | 2026-01-02 14:42 | 477K | |
![[ ]](/icons/compressed.gif) | Time Trax (USA) (Proto).zip | 2026-01-02 14:42 | 568K | |
![[ ]](/icons/compressed.gif) | Time Killers (USA).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Tick, The (USA).zip | 2026-01-02 14:42 | 931K | |
![[ ]](/icons/compressed.gif) | Thunder Fox (USA).zip | 2026-01-02 14:42 | 564K | |
![[ ]](/icons/compressed.gif) | Thunder Force III (Japan, USA).zip | 2026-01-02 14:42 | 338K | |
![[ ]](/icons/compressed.gif) | Thunder Force III (Japan, USA) (Beta) (1990-08-01).zip | 2026-01-02 14:42 | 338K | |
![[ ]](/icons/compressed.gif) | Thunder Force II (USA, Europe).zip | 2026-01-02 14:42 | 372K | |
![[ ]](/icons/compressed.gif) | Thomas the Tank Engine & Friends (USA).zip | 2026-01-02 14:42 | 639K | |
![[ ]](/icons/compressed.gif) | Theme Park (USA, Europe).zip | 2026-01-02 14:42 | 727K | |
![[ ]](/icons/compressed.gif) | The Smurfs Travel the World (U).zip | 2026-01-02 14:42 | 790K | |
![[ ]](/icons/compressed.gif) | The Smurfs (U).zip | 2026-01-02 14:42 | 677K | |
![[ ]](/icons/compressed.gif) | The Ottifants (U).zip | 2026-01-02 14:42 | 445K | |
![[ ]](/icons/compressed.gif) | The Disney Collection - Castle of Illusion Starring Mickey Mouse & QuackShot Starring Donald Duck (U).zip | 2026-01-02 14:42 | 785K | |
![[ ]](/icons/compressed.gif) | Tetris (World) (Genesis Mini, Mega Drive Mini).zip | 2026-01-02 14:42 | 123K | |
![[ ]](/icons/compressed.gif) | Test Drive II - The Duel (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 380K | |
![[ ]](/icons/compressed.gif) | Terminator, The (USA).zip | 2026-01-02 14:42 | 399K | |
![[ ]](/icons/compressed.gif) | Terminator, The (USA) (Beta) (1992-04-14).zip | 2026-01-02 14:42 | 399K | |
![[ ]](/icons/compressed.gif) | Teenage Mutant Ninja Turtles - Tournament Fighters (USA).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Teenage Mutant Ninja Turtles - The Hyperstone Heist (USA).zip | 2026-01-02 14:42 | 650K | |
![[ ]](/icons/compressed.gif) | Tecmo World Cup (USA).zip | 2026-01-02 14:42 | 159K | |
![[ ]](/icons/compressed.gif) | Tecmo Super NBA Basketball (USA).zip | 2026-01-02 14:42 | 633K | |
![[ ]](/icons/compressed.gif) | Tecmo Super Hockey (USA).zip | 2026-01-02 14:42 | 586K | |
![[ ]](/icons/compressed.gif) | Tecmo Super Bowl III - Final Edition (USA).zip | 2026-01-02 14:42 | 872K | |
![[ ]](/icons/compressed.gif) | Tecmo Super Bowl II - Special Edition (USA).zip | 2026-01-02 14:42 | 969K | |
![[ ]](/icons/compressed.gif) | Tecmo Super Bowl (USA).zip | 2026-01-02 14:42 | 439K | |
![[ ]](/icons/compressed.gif) | Tecmo Super Bowl (USA) (Beta).zip | 2026-01-02 14:42 | 437K | |
![[ ]](/icons/compressed.gif) | Tecmo Super Baseball (USA).zip | 2026-01-02 14:42 | 635K | |
![[ ]](/icons/compressed.gif) | Technocop (USA).zip | 2026-01-02 14:42 | 250K | |
![[ ]](/icons/compressed.gif) | Technocop (USA) (Beta) (September, 1990).zip | 2026-01-02 14:42 | 250K | |
![[ ]](/icons/compressed.gif) | Technocop (USA) (Beta) (1990-09-12).zip | 2026-01-02 14:42 | 250K | |
![[ ]](/icons/compressed.gif) | TechnoClash (USA, Europe).zip | 2026-01-02 14:42 | 518K | |
![[ ]](/icons/compressed.gif) | Team USA Basketball (USA, Europe).zip | 2026-01-02 14:42 | 565K | |
![[ ]](/icons/compressed.gif) | Taz-Mania (World).zip | 2026-01-02 14:42 | 333K | |
![[ ]](/icons/compressed.gif) | Taz-Mania (World) (Beta 2).zip | 2026-01-02 14:42 | 333K | |
![[ ]](/icons/compressed.gif) | Taz-Mania (World) (Beta 1).zip | 2026-01-02 14:42 | 333K | |
![[ ]](/icons/compressed.gif) | Taz in Escape from Mars (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Tatsujin ~ Truxton (World).zip | 2026-01-02 14:42 | 225K | |
![[ ]](/icons/compressed.gif) | Task Force Harrier EX (USA).zip | 2026-01-02 14:42 | 577K | |
![[ ]](/icons/compressed.gif) | Target Earth (USA).zip | 2026-01-02 14:42 | 265K | |
![[ ]](/icons/compressed.gif) | Target Earth (USA) (Beta) (1990-02-16).zip | 2026-01-02 14:42 | 265K | |
![[ ]](/icons/compressed.gif) | Tanglewood.zip | 2026-01-02 14:42 | 579K | |
![[ ]](/icons/compressed.gif) | TaleSpin (USA, Europe).zip | 2026-01-02 14:42 | 351K | |
![[ ]](/icons/compressed.gif) | TaleSpin (USA, Europe) (Beta) [b].zip | 2026-01-02 14:42 | 367K | |
![[ ]](/icons/compressed.gif) | T2 - The Arcade Game (USA, Europe).zip | 2026-01-02 14:42 | 474K | |
![[ ]](/icons/compressed.gif) | T2 - The Arcade Game (USA) (Beta) (August, 1992).zip | 2026-01-02 14:42 | 560K | |
![[ ]](/icons/compressed.gif) | T2 - Terminator 2 - Judgment Day (USA, Europe).zip | 2026-01-02 14:42 | 619K | |
![[ ]](/icons/compressed.gif) | Syndicate (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Sylvester and Tweety in Cagey Capers ~ Sylvester & Tweety in Cagey Capers (USA, Europe).zip | 2026-01-02 14:42 | 719K | |
![[ ]](/icons/compressed.gif) | Sylvester & Tweety in Cagey Capers (USA, Europe) (Beta).zip | 2026-01-02 14:42 | 717K | |
![[ ]](/icons/compressed.gif) | Syd of Valis (USA).zip | 2026-01-02 14:42 | 281K | |
![[ ]](/icons/compressed.gif) | Sword of Vermilion (USA, Europe).zip | 2026-01-02 14:42 | 373K | |
![[ ]](/icons/compressed.gif) | Sword of Vermilion (USA, Europe) (1993-11-18) (Sega Channel).zip | 2026-01-02 14:42 | 374K | |
![[ ]](/icons/compressed.gif) | Sword of Sodan (USA, Europe).zip | 2026-01-02 14:42 | 383K | |
![[ ]](/icons/compressed.gif) | Swamp Thing (USA) (Proto).zip | 2026-01-02 14:42 | 209K | |
![[ ]](/icons/compressed.gif) | Superman (USA).zip | 2026-01-02 14:42 | 393K | |
![[ ]](/icons/compressed.gif) | Superman (USA) (Beta).zip | 2026-01-02 14:42 | 390K | |
![[ ]](/icons/compressed.gif) | super_mario_bros..zip | 2026-01-02 14:42 | 608K | |
![[ ]](/icons/compressed.gif) | Super Volleyball (USA).zip | 2026-01-02 14:42 | 90K | |
![[ ]](/icons/compressed.gif) | Super Thunder Blade (World).zip | 2026-01-02 14:42 | 251K | |
![[ ]](/icons/compressed.gif) | Super Street Fighter II (USA).zip | 2026-01-02 14:42 | 2.7M | |
![[ ]](/icons/compressed.gif) | Super Street Fighter II (USA) (Virtual Console).zip | 2026-01-02 14:42 | 2.7M | |
![[ ]](/icons/compressed.gif) | Super Smash T.V. (USA, Europe).zip | 2026-01-02 14:42 | 323K | |
![[ ]](/icons/compressed.gif) | Super Skidmarks (U).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Super Off Road (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 159K | |
![[ ]](/icons/compressed.gif) | Super Monaco GP (USA) (En,Ja).zip | 2026-01-02 14:42 | 386K | |
![[ ]](/icons/compressed.gif) | Super Monaco GP (Japan, USA) (En,Ja).zip | 2026-01-02 14:42 | 385K | |
![[ ]](/icons/compressed.gif) | Super Kick Off (U).zip | 2026-01-02 14:42 | 310K | |
![[ ]](/icons/compressed.gif) | Super Hydlide (USA).zip | 2026-01-02 14:42 | 249K | |
![[ ]](/icons/compressed.gif) | Super Hydlide (USA) (Beta) (1989-10-16).zip | 2026-01-02 14:42 | 250K | |
![[ ]](/icons/compressed.gif) | Super High Impact (USA).zip | 2026-01-02 14:42 | 674K | |
![[ ]](/icons/compressed.gif) | Super Hang-On (World) (Sega Smash Pack).zip | 2026-01-02 14:42 | 252K | |
![[ ]](/icons/compressed.gif) | Super Hang-On (World) (En,Ja).zip | 2026-01-02 14:42 | 252K | |
![[ ]](/icons/compressed.gif) | Super Hang-On (World) (En,Ja) (Rev A).zip | 2026-01-02 14:42 | 253K | |
![[ ]](/icons/compressed.gif) | Super Hang-On (World) (En,Ja) (Beta) (1989-08-18) (Sega Channel).zip | 2026-01-02 14:42 | 252K | |
![[ ]](/icons/compressed.gif) | Super Fantasy Zone (USA) (Ja) (Genesis Mini).zip | 2026-01-02 14:42 | 431K | |
![[ ]](/icons/compressed.gif) | Super Fantasy Zone (USA) (En) (Genesis Mini).zip | 2026-01-02 14:42 | 429K | |
![[ ]](/icons/compressed.gif) | Super Battleship - The Classic Naval Combat Game (USA).zip | 2026-01-02 14:42 | 223K | |
![[ ]](/icons/compressed.gif) | Super Baseball 2020 (USA, Europe).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Sunset Riders (USA).zip | 2026-01-02 14:42 | 357K | |
![[ ]](/icons/compressed.gif) | Summer Challenge (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 608K | |
![[ ]](/icons/compressed.gif) | Sub-Terrania (USA).zip | 2026-01-02 14:42 | 937K | |
![[ ]](/icons/compressed.gif) | Sub-Terrania (USA) (Beta) (October, 1993).zip | 2026-01-02 14:42 | 920K | |
![[ ]](/icons/compressed.gif) | Sub-Terrania (USA) (Beta) (July, 1993).zip | 2026-01-02 14:42 | 621K | |
![[ ]](/icons/compressed.gif) | Striker (U).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Strider (USA, Europe).zip | 2026-01-02 14:42 | 659K | |
![[ ]](/icons/compressed.gif) | Strider (USA, Europe) (Virtual Console).zip | 2026-01-02 14:42 | 670K | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-04-13).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-04-12).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-04-11).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-04-08).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-04-04).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-04-01).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Rev A) (Beta) (1994-03-28).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Beta) (1994-03-18).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Beta) (1994-03-17).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 3 (USA) (Beta) (1994-03-08).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Streets of Rage 2 (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Street Smart (Japan, USA).zip | 2026-01-02 14:42 | 203K | |
![[ ]](/icons/compressed.gif) | Street Smart (Japan, USA) (Beta) (1990-06-29).zip | 2026-01-02 14:42 | 201K | |
![[ ]](/icons/compressed.gif) | Street Fighter II' - Special Champion Edition (USA).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | Street Fighter II' - Special Champion Edition (USA) (Virtual Console).zip | 2026-01-02 14:42 | 1.5M | |
![[ ]](/icons/compressed.gif) | Street Fighter II' - Champion Edition (USA) (Beta) (1993-07-30).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Stormlord (USA).zip | 2026-01-02 14:42 | 258K | |
![[ ]](/icons/compressed.gif) | Stone Protectors (USA) (Proto).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Steel Talons (USA, Europe).zip | 2026-01-02 14:42 | 244K | |
![[ ]](/icons/compressed.gif) | Steel Talons (USA, Europe) (Beta).zip | 2026-01-02 14:42 | 244K | |
![[ ]](/icons/compressed.gif) | Steel Empire (USA).zip | 2026-01-02 14:42 | 462K | |
![[ ]](/icons/compressed.gif) | Steel Empire (USA) (1992-03-13) (Sega Channel).zip | 2026-01-02 14:42 | 462K | |
![[ ]](/icons/compressed.gif) | Stargate (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Stargate (USA, Europe) (Sample) (NGen).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Stargate (USA, Europe) (Beta).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Starflight (USA, Europe).zip | 2026-01-02 14:42 | 423K | |
![[ ]](/icons/compressed.gif) | Starflight (USA, Europe) (Rev A).zip | 2026-01-02 14:42 | 423K | |
![[ ]](/icons/compressed.gif) | Star Wars (USA) (Proto) (1993-01-25).zip | 2026-01-02 14:42 | 544K | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation (USA) (Beta) (1994-01-25).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation (USA) (Beta) (1994-01-18).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation (USA) (Beta) (1994-01-10).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation (USA) (Beta) (1994-01-03).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation (USA) (Beta) (1993-12-29).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation (USA) (Beta) (1993-12-28).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation - Echoes from the Past (USA).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - The Next Generation - Echoes from the Past (USA) (Rev A).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Star Trek - Deep Space Nine - Crossroads of Time (USA).zip | 2026-01-02 14:42 | 596K | |
![[ ]](/icons/compressed.gif) | Star Odyssey (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 593K | |
![[ ]](/icons/compressed.gif) | Star Odyssey (USA) (Beta) (1992-01-16).zip | 2026-01-02 14:42 | 476K | |
![[ ]](/icons/compressed.gif) | Star Control (USA, Europe) (Unl).zip | 2026-01-02 14:42 | 663K | |
![[ ]](/icons/compressed.gif) | ST II' Turbo (USA) (Proto) (Unl) (Pirate).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Spot Goes to Hollywood (USA).zip | 2026-01-02 14:42 | 1.8M | |
![[ ]](/icons/compressed.gif) | Sports Talk Baseball (USA).zip | 2026-01-02 14:42 | 586K | |
![[ ]](/icons/compressed.gif) | Splatterhouse 3 (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Splatterhouse 2 (USA).zip | 2026-01-02 14:42 | 454K | |
![[ ]](/icons/compressed.gif) | Splatterhouse 2 (USA) (1992-03-02) (Sega Channel).zip | 2026-01-02 14:42 | 454K | |
![[ ]](/icons/compressed.gif) | Spirou (U).zip | 2026-01-02 14:42 | 692K | |
![[ ]](/icons/compressed.gif) | Spiritual Warfare (USA) (Unl).zip | 2026-01-02 14:42 | 147K | |
![[ ]](/icons/compressed.gif) | Spider-Man X-Men - Arcade's Revenge (USA, Europe).zip | 2026-01-02 14:42 | 445K | |
![[ ]](/icons/compressed.gif) | Spider-Man . Venom - Maximum Carnage (World).zip | 2026-01-02 14:42 | 942K | |
![[ ]](/icons/compressed.gif) | Spider-Man (World) (Sega).zip | 2026-01-02 14:42 | 379K | |
![[ ]](/icons/compressed.gif) | Spider-Man (USA, Europe) (Acclaim).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Spider-Man (USA, Europe) (Acclaim) (Beta) (August, 1994).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Spider-Man (USA, Europe) (Acclaim) (Beta) (1994-12-12).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Speedball 2 - Brutal Deluxe (USA).zip | 2026-01-02 14:42 | 251K | |
![[ ]](/icons/compressed.gif) | Speedball 2 - Brutal Deluxe (USA) (Beta) (1991-06-07).zip | 2026-01-02 14:42 | 251K | |
![[ ]](/icons/compressed.gif) | Sparkster (USA).zip | 2026-01-02 14:42 | 616K | |
![[ ]](/icons/compressed.gif) | Space Invaders '91 (USA).zip | 2026-01-02 14:42 | 105K | |
![[ ]](/icons/compressed.gif) | Space Harrier II (World).zip | 2026-01-02 14:42 | 292K | |
![[ ]](/icons/compressed.gif) | Sorcerer's Kingdom (USA).zip | 2026-01-02 14:42 | 415K | |
![[ ]](/icons/compressed.gif) | Sorcerer's Kingdom (USA) (Rev A).zip | 2026-01-02 14:42 | 415K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 3 (USA).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 3 (USA) (Sonic Classic Collection).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 3 (USA) (1993-11-20) (Sega Channel).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World).zip | 2026-01-02 14:42 | 732K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Rev B).zip | 2026-01-02 14:42 | 729K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Rev A).zip | 2026-01-02 14:42 | 732K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Rev A) (Sonic Classic Collection).zip | 2026-01-02 14:42 | 733K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (September, 1992).zip | 2026-01-02 14:42 | 708K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (June, 1992).zip | 2026-01-02 14:42 | 517K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (July, 1992).zip | 2026-01-02 14:42 | 623K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-09-24).zip | 2026-01-02 14:42 | 732K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-09-24) (Alt 1).zip | 2026-01-02 14:42 | 729K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-09-22).zip | 2026-01-02 14:42 | 730K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-09-21).zip | 2026-01-02 14:42 | 727K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-09-18).zip | 2026-01-02 14:42 | 715K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-09-14).zip | 2026-01-02 14:42 | 705K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (World) (Beta) (1992-08-21).zip | 2026-01-02 14:42 | 639K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog 2 (USA, Europe) (Rev A) (Virtual Console).zip | 2026-01-02 14:42 | 733K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog (USA, Europe).zip | 2026-01-02 14:42 | 378K | |
![[ ]](/icons/compressed.gif) | Sonic The Hedgehog (USA, Europe) (Sonic Classic Collection).zip | 2026-01-02 14:42 | 379K | |
![[ ]](/icons/compressed.gif) | Sonic Spinball (USA).zip | 2026-01-02 14:42 | 515K | |
![[ ]](/icons/compressed.gif) | Sonic Spinball (USA) (Beta) (October, 1993).zip | 2026-01-02 14:42 | 515K | |
![[ ]](/icons/compressed.gif) | Sonic Spinball (USA) (1993-09-22) (Sega Channel).zip | 2026-01-02 14:42 | 515K | |
![[ ]](/icons/compressed.gif) | Sonic Compilation ~ Sonic Classics (USA, Europe, Korea) (Rev A).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Sonic Classic Heroes.zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Sonic All-Stars.zip | 2026-01-02 14:42 | 3.7M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast ~ Sonic 3D Flickies' Island (USA, Europe, Korea).zip | 2026-01-02 14:42 | 2.5M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-09-04).zip | 2026-01-02 14:42 | 2.5M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-08-31).zip | 2026-01-02 14:42 | 2.5M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-08-30).zip | 2026-01-02 14:42 | 2.5M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-08-25).zip | 2026-01-02 14:42 | 2.5M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-08-19).zip | 2026-01-02 14:42 | 1.7M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-08-14).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast (USA, Europe, Korea) (Beta) (1996-07-03).zip | 2026-01-02 14:42 | 946K | |
![[ ]](/icons/compressed.gif) | Sonic 3D Blast - Director's Cut (World) (Unl).zip | 2026-01-02 14:42 | 2.4M | |
![[ ]](/icons/compressed.gif) | Sonic 3 Complete.zip | 2026-01-02 14:42 | 2.1M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles + Sonic The Hedgehog 3 (USA).zip | 2026-01-02 14:42 | 2.4M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles + Sonic The Hedgehog 2 + Sonic The Hedgehog 3 (World) (Virtual Console).zip | 2026-01-02 14:42 | 3.3M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles + Sonic The Hedgehog 2 (World).zip | 2026-01-02 14:42 | 2.1M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles + Sonic The Hedgehog 2 (World) (Beta) (1994-05-24).zip | 2026-01-02 14:42 | 2.1M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles + Sonic The Hedgehog (USA, Europe).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Sonic Classic Collection).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-06-19).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-06-18).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-06-12).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-06-10).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-06-08).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-06-06).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sonic & Knuckles (World) (Beta) (1994-05-25).zip | 2026-01-02 14:42 | 2.4M | |
![[ ]](/icons/compressed.gif) | Soldiers of Fortune (USA).zip | 2026-01-02 14:42 | 789K | |
![[ ]](/icons/compressed.gif) | Sol-Deace (USA).zip | 2026-01-02 14:42 | 363K | |
![[ ]](/icons/compressed.gif) | Sol-Deace (USA) (1992-02-03) (Sega Channel).zip | 2026-01-02 14:42 | 363K | |
![[ ]](/icons/compressed.gif) | Socket (USA).zip | 2026-01-02 14:42 | 416K | |
![[ ]](/icons/compressed.gif) | Snow Bros. - Nick & Tom.zip | 2026-01-02 14:42 | 372K | |
![[ ]](/icons/compressed.gif) | SMB4MD.zip | 2026-01-02 14:42 | 39K | |
![[ ]](/icons/compressed.gif) | Smart Mouse (World) (Unl).zip | 2026-01-02 14:42 | 139K | |
![[ ]](/icons/compressed.gif) | Slaughter Sport (USA).zip | 2026-01-02 14:42 | 344K | |
![[ ]](/icons/compressed.gif) | Slam - Shaq vs. the Legends (USA) (Proto).zip | 2026-01-02 14:42 | 950K | |
![[ ]](/icons/compressed.gif) | Skitchin' (USA, Europe).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Skeleton Krew (USA).zip | 2026-01-02 14:42 | 771K | |
![[ ]](/icons/compressed.gif) | Simpsons, The - Bart's Nightmare (USA, Europe).zip | 2026-01-02 14:42 | 629K | |
![[ ]](/icons/compressed.gif) | Simpsons, The - Bart vs. the Space Mutants (USA, Europe).zip | 2026-01-02 14:42 | 200K | |
![[ ]](/icons/compressed.gif) | Simpsons, The - Bart vs. the Space Mutants (USA, Europe) (Rev A).zip | 2026-01-02 14:42 | 192K | |
![[ ]](/icons/compressed.gif) | Side Pocket (USA).zip | 2026-01-02 14:42 | 461K | |
![[ ]](/icons/compressed.gif) | Shove It! ...The Warehouse Game (USA).zip | 2026-01-02 14:42 | 48K | |
![[ ]](/icons/compressed.gif) | Ship (World) (Proto).zip | 2026-01-02 14:42 | 28K | |
![[ ]](/icons/compressed.gif) | Shinobi III - Return of the Ninja Master (USA).zip | 2026-01-02 14:42 | 622K | |
![[ ]](/icons/compressed.gif) | Shinobi III - Return of the Ninja Master (USA) (Beta) (1993-06-29).zip | 2026-01-02 14:42 | 622K | |
![[ ]](/icons/compressed.gif) | Shining in the Darkness (USA, Europe).zip | 2026-01-02 14:42 | 614K | |
![[ ]](/icons/compressed.gif) | Shining Force II (USA).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Shining Force II (USA) (Beta) (1994-06-07).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Shining Force II (USA) (Beta) (1994-04-04).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Shining Force (USA).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Shining Force (USA) (Beta).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Shaq-Fu (USA, Europe).zip | 2026-01-02 14:42 | 2.0M | |
![[ ]](/icons/compressed.gif) | Shanghai II - Dragon's Eye (USA).zip | 2026-01-02 14:42 | 539K | |
![[ ]](/icons/compressed.gif) | Shanghai II - Dragon's Eye (USA) (Beta).zip | 2026-01-02 14:42 | 539K | |
![[ ]](/icons/compressed.gif) | Shane Warne Cricket (U).zip | 2026-01-02 14:42 | 534K | |
![[ ]](/icons/compressed.gif) | Shadowrun (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Shadowrun (USA) (Beta) (1994-01-25).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Shadowrun (USA) (Beta) (1994-01-25) (Alt 1).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Shadowrun (USA) (Beta) (1993-12-31).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Shadowrun (USA) (Beta) (1993-12-28).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Shadow of the Beast II (USA, Europe).zip | 2026-01-02 14:42 | 382K | |
![[ ]](/icons/compressed.gif) | Shadow of the Beast (USA, Europe).zip | 2026-01-02 14:42 | 356K | |
![[ ]](/icons/compressed.gif) | Shadow Dancer - The Secret of Shinobi (World).zip | 2026-01-02 14:42 | 339K | |
![[ ]](/icons/compressed.gif) | Shadow Dancer - The Secret of Shinobi (World) (Beta) (1990-10-02).zip | 2026-01-02 14:42 | 338K | |
![[ ]](/icons/compressed.gif) | Shadow Dancer - The Secret of Shinobi (USA, Europe) (Steam Version).zip | 2026-01-02 14:42 | 339K | |
![[ ]](/icons/compressed.gif) | Shadow Blasters (USA).zip | 2026-01-02 14:42 | 276K | |
![[ ]](/icons/compressed.gif) | Sesame Street Counting Cafe (USA).zip | 2026-01-02 14:42 | 502K | |
![[ ]](/icons/compressed.gif) | Sensible Soccer - International Edition (U).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Sensible Soccer - European Champions (U).zip | 2026-01-02 14:42 | 222K | |
![[ ]](/icons/compressed.gif) | Senjou no Ookami II ~ Mercs (World).zip | 2026-01-02 14:42 | 636K | |
![[ ]](/icons/compressed.gif) | Sega Sports 1 - Super Monaco + Wimbledon + Ultimate Soccer (U).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Sega Sound Tool (USA) (v2.2) (Program).zip | 2026-01-02 14:42 | 4.4K | |
![[ ]](/icons/compressed.gif) | Sega Channel Demo (USA) (Program).zip | 2026-01-02 14:42 | 85K | |
![[ ]](/icons/compressed.gif) | Sega Channel (USA) (Scientific Atlanta) (Program).zip | 2026-01-02 14:42 | 128K | |
![[ ]](/icons/compressed.gif) | Sega Channel (USA) (General Instrument) (Program).zip | 2026-01-02 14:42 | 143K | |
![[ ]](/icons/compressed.gif) | Second Samurai (U).zip | 2026-01-02 14:42 | 649K | |
![[ ]](/icons/compressed.gif) | seaQuest DSV (USA).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Scooby-Doo Mystery (USA).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Saturday Night Slammasters (USA).zip | 2026-01-02 14:42 | 2.4M | |
![[ ]](/icons/compressed.gif) | Samurai Shodown (USA).zip | 2026-01-02 14:42 | 1.7M | |
![[ ]](/icons/compressed.gif) | Sampras Tennis 96 (U).zip | 2026-01-02 14:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | Saint Sword (USA).zip | 2026-01-02 14:42 | 341K | |
![[ ]](/icons/compressed.gif) | Sailor Moon (JU).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Sagaia (USA).zip | 2026-01-02 14:42 | 420K | |
![[ ]](/icons/compressed.gif) | Rugby World Cup 95 (USA, Europe) (En,Fr,It).zip | 2026-01-02 14:42 | 664K | |
![[ ]](/icons/compressed.gif) | Romance of the Three Kingdoms III - Dragon of Destiny (USA).zip | 2026-01-02 14:42 | 697K | |
![[ ]](/icons/compressed.gif) | Romance of the Three Kingdoms II (USA).zip | 2026-01-02 14:42 | 438K | |
![[ ]](/icons/compressed.gif) | Rolo to the Rescue (USA, Europe).zip | 2026-01-02 14:42 | 296K | |
![[ ]](/icons/compressed.gif) | Rolling Thunder 3 (USA).zip | 2026-01-02 14:42 | 711K | |
![[ ]](/icons/compressed.gif) | Rolling Thunder 2 (USA).zip | 2026-01-02 14:42 | 647K | |
![[ ]](/icons/compressed.gif) | Roger Clemens' MVP Baseball (USA).zip | 2026-01-02 14:42 | 454K | |
![[ ]](/icons/compressed.gif) | Rocket Knight Adventures (USA).zip | 2026-01-02 14:42 | 656K | |
![[ ]](/icons/compressed.gif) | Rocket Knight Adventures (USA) (Sample) (1993-06-15).zip | 2026-01-02 14:42 | 656K | |
![[ ]](/icons/compressed.gif) | Rock n' Roll Racing (USA).zip | 2026-01-02 14:42 | 653K | |
![[ ]](/icons/compressed.gif) | Robot Wreckage (USA) (Beta) (July, 1992).zip | 2026-01-02 14:42 | 240K | |
![[ ]](/icons/compressed.gif) | RoboCop versus The Terminator (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | RoboCop versus The Terminator (USA) (Beta) (1993-04-30).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | RoboCop 3 (USA, Europe).zip | 2026-01-02 14:42 | 316K | |
![[ ]](/icons/compressed.gif) | RoadBlasters (USA).zip | 2026-01-02 14:42 | 239K | |
![[ ]](/icons/compressed.gif) | RoadBlasters (USA) (Beta) (1991-06-27).zip | 2026-01-02 14:42 | 240K | |
![[ ]](/icons/compressed.gif) | Road Rash II (USA, Europe) (RR206).zip | 2026-01-02 14:42 | 545K | |
![[ ]](/icons/compressed.gif) | Road Rash II (USA, Europe) (RR205).zip | 2026-01-02 14:42 | 545K | |
![[ ]](/icons/compressed.gif) | Road Rash 3 (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Road Rash 3 (USA, Europe) (Beta) (1994-11-19).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Road Rash (USA, Europe).zip | 2026-01-02 14:42 | 392K | |
![[ ]](/icons/compressed.gif) | Ristar (USA, Europe).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Ristar (USA, Europe) (Beta) (Later).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Risky Woods (USA, Europe).zip | 2026-01-02 14:42 | 445K | |
![[ ]](/icons/compressed.gif) | Risk (USA).zip | 2026-01-02 14:42 | 318K | |
![[ ]](/icons/compressed.gif) | Rise of the Robots (U).zip | 2026-01-02 14:42 | 1.7M | |
![[ ]](/icons/compressed.gif) | Rings of Power (USA, Europe).zip | 2026-01-02 14:42 | 607K | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-08-26).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-08-26) (Alt 1).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-08-25).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-08-17).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-08-15).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-08-09).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Richard Scarry's Busytown (USA) (Beta) (1994-07-21).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Revolution X (USA, Europe).zip | 2026-01-02 14:42 | 1.7M | |
![[ ]](/icons/compressed.gif) | Revenge of Shinobi, The (World) (Rev B) (Virtual Console).zip | 2026-01-02 14:42 | 359K | |
![[ ]](/icons/compressed.gif) | Revenge of Shinobi, The (USA, Europe).zip | 2026-01-02 14:42 | 359K | |
![[ ]](/icons/compressed.gif) | Revenge of Shinobi, The (USA, Europe) (Rev B).zip | 2026-01-02 14:42 | 358K | |
![[ ]](/icons/compressed.gif) | Revenge of Shinobi, The (USA, Europe) (Rev A).zip | 2026-01-02 14:42 | 360K | |
![[ ]](/icons/compressed.gif) | Revenge of Shinobi, The (USA, Europe) (Rev A) (Beta) (1990-02-01).zip | 2026-01-02 14:42 | 360K | |
![[ ]](/icons/compressed.gif) | Ren & Stimpy Show Presents, The - Stimpy's Invention (USA).zip | 2026-01-02 14:42 | 672K | |
![[ ]](/icons/compressed.gif) | Ren & Stimpy Show Presents, The - Stimpy's Invention (USA) (Beta).zip | 2026-01-02 14:42 | 424K | |
![[ ]](/icons/compressed.gif) | Red Zone (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Rastan Saga II (USA).zip | 2026-01-02 14:42 | 164K | |
![[ ]](/icons/compressed.gif) | Ranger X (USA).zip | 2026-01-02 14:42 | 572K | |
![[ ]](/icons/compressed.gif) | Rampart (USA).zip | 2026-01-02 14:42 | 275K | |
![[ ]](/icons/compressed.gif) | Rambo III (World) (Rev A).zip | 2026-01-02 14:42 | 186K | |
![[ ]](/icons/compressed.gif) | Rainbow Islands - The Story of Bubble Bobble 2 (JU) [b1].zip | 2026-01-02 14:42 | 217K | |
![[ ]](/icons/compressed.gif) | Raiden Densetsu ~ Raiden Trad (Japan, USA).zip | 2026-01-02 14:42 | 478K | |
![[ ]](/icons/compressed.gif) | Radical Rex (USA).zip | 2026-01-02 14:42 | 633K | |
![[ ]](/icons/compressed.gif) | Race Drivin' (USA).zip | 2026-01-02 14:42 | 155K | |
![[ ]](/icons/compressed.gif) | R.B.I. Baseball '94 (USA, Europe).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | R.B.I. Baseball '93 (USA).zip | 2026-01-02 14:42 | 526K | |
![[ ]](/icons/compressed.gif) | R.B.I. Baseball 4 (USA).zip | 2026-01-02 14:42 | 510K | |
![[ ]](/icons/compressed.gif) | R.B.I. Baseball 3 (USA).zip | 2026-01-02 14:42 | 207K | |
![[ ]](/icons/compressed.gif) | R.B.I. Baseball 3 (USA) (Beta) (1991-07-18).zip | 2026-01-02 14:42 | 205K | |
![[ ]](/icons/compressed.gif) | Quad Challenge (USA).zip | 2026-01-02 14:42 | 251K | |
![[ ]](/icons/compressed.gif) | QuackShot Starring Donald Duck ~ QuackShot - I Love Donald Duck - Guruzia Ou no Hihou (World).zip | 2026-01-02 14:42 | 392K | |
![[ ]](/icons/compressed.gif) | QuackShot Starring Donald Duck ~ QuackShot - I Love Donald Duck - Guruzia Ou no Hihou (World) (Rev A).zip | 2026-01-02 14:42 | 394K | |
![[ ]](/icons/compressed.gif) | QuackShot Starring Donald Duck ~ QuackShot - I Love Donald Duck - Guruzia Ou no Hihou (World) (Rev A) (Alt 1).zip | 2026-01-02 14:42 | 912K | |
![[ ]](/icons/compressed.gif) | Punisher, The (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Puggsy (USA).zip | 2026-01-02 14:42 | 761K | |
![[ ]](/icons/compressed.gif) | Puggsy (USA) (Beta).zip | 2026-01-02 14:42 | 34K | |
![[ ]](/icons/compressed.gif) | Psy-O-Blade (JU).zip | 2026-01-02 14:42 | 551K | |
![[ ]](/icons/compressed.gif) | Psycho Pinball (U).zip | 2026-01-02 14:42 | 749K | |
![[ ]](/icons/compressed.gif) | Pro Quarterback (USA).zip | 2026-01-02 14:42 | 498K | |
![[ ]](/icons/compressed.gif) | Pro Moves Soccer (USA).zip | 2026-01-02 14:42 | 315K | |
![[ ]](/icons/compressed.gif) | Pringles.zip | 2026-01-02 14:42 | 66K | |
![[ ]](/icons/compressed.gif) | Prince of Persia (USA).zip | 2026-01-02 14:42 | 384K | |
![[ ]](/icons/compressed.gif) | Prime Time NFL Starring Deion Sanders (USA).zip | 2026-01-02 14:42 | 1.0M | |
![[ ]](/icons/compressed.gif) | Primal Rage Showdown (USA) (Demo) (1995-08-26) (Sega Channel).zip | 2026-01-02 14:42 | 2.3M | |
![[ ]](/icons/compressed.gif) | Primal Rage (USA, Europe).zip | 2026-01-02 14:42 | 2.3M | |
![[ ]](/icons/compressed.gif) | Primal Rage (USA) (Demo) (1995-08-25) (Sega Channel) (Rental Version).zip | 2026-01-02 14:42 | 2.3M | |
![[ ]](/icons/compressed.gif) | Primal Rage (USA) (Demo) (1995-08-01) (Sega Channel) (Test Drive Version).zip | 2026-01-02 14:42 | 1.8M | |
![[ ]](/icons/compressed.gif) | Premier Manager 97 (U).zip | 2026-01-02 14:42 | 386K | |
![[ ]](/icons/compressed.gif) | Premier Manager (U).zip | 2026-01-02 14:42 | 387K | |
![[ ]](/icons/compressed.gif) | Predator 2 (USA, Europe).zip | 2026-01-02 14:42 | 481K | |
![[ ]](/icons/compressed.gif) | Powerball (USA).zip | 2026-01-02 14:42 | 301K | |
![[ ]](/icons/compressed.gif) | Power Monger (USA, Europe).zip | 2026-01-02 14:42 | 318K | |
![[ ]](/icons/compressed.gif) | Power Drive (U).zip | 2026-01-02 14:42 | 663K | |
![[ ]](/icons/compressed.gif) | Populous (USA) (Unl).zip | 2026-01-02 14:42 | 180K | |
![[ ]](/icons/compressed.gif) | Pocahontas (USA).zip | 2026-01-02 14:42 | 1.6M | |
![[ ]](/icons/compressed.gif) | Pit-Fighter (World) (En,Ja).zip | 2026-01-02 14:42 | 630K | |
![[ ]](/icons/compressed.gif) | Pit-Fighter (World) (Beta).zip | 2026-01-02 14:42 | 628K | |
![[ ]](/icons/compressed.gif) | Pitfall - The Mayan Adventure (USA).zip | 2026-01-02 14:42 | 1.3M | |
![[ ]](/icons/compressed.gif) | Pirates! Gold (USA).zip | 2026-01-02 14:42 | 710K | |
![[ ]](/icons/compressed.gif) | Pirates! Gold (USA) (Beta 2).zip | 2026-01-02 14:42 | 792K | |
![[ ]](/icons/compressed.gif) | Pirates! Gold (USA) (Beta 1).zip | 2026-01-02 14:42 | 782K | |
![[ ]](/icons/compressed.gif) | Pirates of Dark Water, The (USA).zip | 2026-01-02 14:42 | 1.1M | |
![[ ]](/icons/compressed.gif) | Pinocchio (USA).zip | 2026-01-02 14:42 | 1.4M | |
![[ ]](/icons/compressed.gif) | Pink Goes to Hollywood (USA, Europe).zip | 2026-01-02 14:42 | 616K | |
![[ ]](/icons/compressed.gif) | Pink Goes to Hollywood (USA, Europe) (Beta).zip | 2026-01-02 14:42 | 616K | |
![[ ]](/icons/compressed.gif) | Pier Solar and the Great Architects (World) (En,Fr,Es) (Unl).zip | 2026-01-02 14:42 | 4.0M | |
![[ ]](/icons/compressed.gif) | Pier Solar and the Great Architects (World) (En,Fr,De) (Reprint) (Unl).zip | 2026-01-02 14:42 | 4.0M | |
![[ ]](/icons/compressed.gif) | Pier Solar and the Great Architects (World) (En,Fr,De) (Reprint A) (Unl).zip | 2026-01-02 14:42 | 4.0M | |
![[ ]](/icons/compressed.gif) | Pier Solar and the Great Architects (World) (En,Es,Pt) (Reprint B) (Unl).zip | 2026-01-02 14:41 | 4.0M | |
![[ ]](/icons/compressed.gif) | Pier Solar and the Great Architects (World) (Beta) (Unl).zip | 2026-01-02 14:41 | 826K | |
![[ ]](/icons/compressed.gif) | Phelios (USA).zip | 2026-01-02 14:41 | 254K | |
![[ ]](/icons/compressed.gif) | Phantom 2040 (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA).zip | 2026-01-02 14:41 | 2.3M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA) (Sample).zip | 2026-01-02 14:41 | 2.3M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA) (Beta) (1994-11-07).zip | 2026-01-02 14:41 | 2.7M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA) (Beta) (1994-10-27).zip | 2026-01-02 14:41 | 2.3M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA) (Beta) (1994-08-15).zip | 2026-01-02 14:41 | 2.3M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA) (Beta) (1994-06-08).zip | 2026-01-02 14:41 | 2.3M | |
![[ ]](/icons/compressed.gif) | Phantasy Star IV (USA) (Beta) (1994-05-30).zip | 2026-01-02 14:41 | 2.3M | |
![[ ]](/icons/compressed.gif) | Phantasy Star III - Generations of Doom (USA, Europe, Korea).zip | 2026-01-02 14:41 | 441K | |
![[ ]](/icons/compressed.gif) | Phantasy Star III - Generations of Doom (USA, Europe) (Steam Version).zip | 2026-01-02 14:41 | 442K | |
![[ ]](/icons/compressed.gif) | Phantasy Star II (USA, Europe).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Phantasy Star II (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Phantasy Star II (USA, Europe) (Rev A) (Virtual Console).zip | 2026-01-02 14:41 | 474K | |
![[ ]](/icons/compressed.gif) | Phantasy Star II (USA, Europe) (Rev A) (Steam Version).zip | 2026-01-02 14:41 | 470K | |
![[ ]](/icons/compressed.gif) | Phantasy Star II (USA, Europe) (Beta) (1989-07-28).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | PGA Tour Golf III (USA, Europe).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | PGA Tour Golf II (USA, Europe).zip | 2026-01-02 14:41 | 652K | |
![[ ]](/icons/compressed.gif) | PGA Tour Golf II (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 614K | |
![[ ]](/icons/compressed.gif) | PGA Tour Golf (USA, Europe) (PGA09).zip | 2026-01-02 14:41 | 340K | |
![[ ]](/icons/compressed.gif) | PGA Tour Golf (USA, Europe) (PGA07).zip | 2026-01-02 14:41 | 340K | |
![[ ]](/icons/compressed.gif) | PGA Tour 96 (USA, Europe).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | PGA European Tour (USA, Europe).zip | 2026-01-02 14:41 | 621K | |
![[ ]](/icons/compressed.gif) | Pete Sampras Tennis (USA, Europe) (Rev 2) (MDSTEE13).zip | 2026-01-02 14:41 | 639K | |
![[ ]](/icons/compressed.gif) | Pete Sampras Tennis (USA, Europe) (Rev 1) (MDST17FF) (J-Cart).zip | 2026-01-02 14:41 | 639K | |
![[ ]](/icons/compressed.gif) | Pete Sampras Tennis (USA, Europe) (MDST6636) (J-Cart).zip | 2026-01-02 14:41 | 635K | |
![[ ]](/icons/compressed.gif) | Pele! (USA, Europe).zip | 2026-01-02 14:41 | 555K | |
![[ ]](/icons/compressed.gif) | Pele! (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 227K | |
![[ ]](/icons/compressed.gif) | Pele II - World Tournament Soccer (USA, Europe).zip | 2026-01-02 14:41 | 714K | |
![[ ]](/icons/compressed.gif) | Pebble Beach Golf Links (USA).zip | 2026-01-02 14:41 | 641K | |
![[ ]](/icons/compressed.gif) | Pebble Beach Golf Links (USA) (Rev A) (1994-02-14) (Sega Channel).zip | 2026-01-02 14:41 | 641K | |
![[ ]](/icons/compressed.gif) | Pat Riley Basketball (USA).zip | 2026-01-02 14:41 | 189K | |
![[ ]](/icons/compressed.gif) | Pat Riley Basketball (USA) (Beta) (1990-06-14).zip | 2026-01-02 14:41 | 190K | |
![[ ]](/icons/compressed.gif) | Paperboy 2 (USA, Europe).zip | 2026-01-02 14:41 | 441K | |
![[ ]](/icons/compressed.gif) | Paperboy (USA, Europe).zip | 2026-01-02 14:41 | 242K | |
![[ ]](/icons/compressed.gif) | Paperboy (USA, Europe) (Beta) (1991-10-28).zip | 2026-01-02 14:41 | 242K | |
![[ ]](/icons/compressed.gif) | Panorama Cotton (USA).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Pagemaster, The (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Pagemaster, The (USA) (Beta).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Pac-Mania (USA, Europe).zip | 2026-01-02 14:41 | 73K | |
![[ ]](/icons/compressed.gif) | Pac-Man 2 - The New Adventures (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Pac-Attack (USA).zip | 2026-01-02 14:41 | 153K | |
![[ ]](/icons/compressed.gif) | P.T.O. - Pacific Theater of Operations (USA).zip | 2026-01-02 14:41 | 494K | |
![[ ]](/icons/compressed.gif) | OutRunners (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | OutRun 2019 (USA).zip | 2026-01-02 14:41 | 531K | |
![[ ]](/icons/compressed.gif) | OutRun 2019 (USA) (Beta).zip | 2026-01-02 14:41 | 531K | |
![[ ]](/icons/compressed.gif) | OutRun (USA, Europe).zip | 2026-01-02 14:41 | 501K | |
![[ ]](/icons/compressed.gif) | OutRun (USA, Europe) (Sega Smash Pack).zip | 2026-01-02 14:41 | 501K | |
![[ ]](/icons/compressed.gif) | Outlander (USA).zip | 2026-01-02 14:41 | 412K | |
![[ ]](/icons/compressed.gif) | Outlander (USA) (Beta).zip | 2026-01-02 14:41 | 410K | |
![[ ]](/icons/compressed.gif) | Out of This World (USA).zip | 2026-01-02 14:41 | 504K | |
![[ ]](/icons/compressed.gif) | Out of This World (USA) (Beta).zip | 2026-01-02 14:41 | 590K | |
![[ ]](/icons/compressed.gif) | Operation Europe - Path to Victory 1939-45 (USA).zip | 2026-01-02 14:41 | 597K | |
![[ ]](/icons/compressed.gif) | Ooze, The (USA) (Beta) (1995-06-29).zip | 2026-01-02 14:41 | 522K | |
![[ ]](/icons/compressed.gif) | Ooze, The (USA) (Beta) (1995-06-29) (Alt 1).zip | 2026-01-02 14:41 | 523K | |
![[ ]](/icons/compressed.gif) | Ooze, The (USA) (Beta) (1995-06-26).zip | 2026-01-02 14:41 | 517K | |
![[ ]](/icons/compressed.gif) | Ooze, The (USA) (Beta) (1995-06-22).zip | 2026-01-02 14:41 | 514K | |
![[ ]](/icons/compressed.gif) | Ooze, The (USA) (Beta) (1995-06-19).zip | 2026-01-02 14:41 | 504K | |
![[ ]](/icons/compressed.gif) | Ooze, The (USA) (Beta) (1995-06-15).zip | 2026-01-02 14:41 | 490K | |
![[ ]](/icons/compressed.gif) | Ooze, The (Japan, USA).zip | 2026-01-02 14:41 | 519K | |
![[ ]](/icons/compressed.gif) | Onslaught (USA, Europe) (Unl).zip | 2026-01-02 14:41 | 231K | |
![[ ]](/icons/compressed.gif) | Olympic Summer Games (USA, Europe).zip | 2026-01-02 14:41 | 702K | |
![[ ]](/icons/compressed.gif) | Olympic Gold (Japan, USA, Korea) (En,Fr,De,Es,It,Nl,Pt,Sv) (Rev A).zip | 2026-01-02 14:41 | 250K | |
![[ ]](/icons/compressed.gif) | Olympic Gold (Japan, USA) (En,Fr,De,Es,It,Nl,Pt,Sv).zip | 2026-01-02 14:41 | 249K | |
![[ ]](/icons/compressed.gif) | Oh Mummy Genesis (World) (Unl).zip | 2026-01-02 14:41 | 296K | |
![[ ]](/icons/compressed.gif) | Normy's Beach Babe-O-Rama (USA, Europe).zip | 2026-01-02 14:41 | 542K | |
![[ ]](/icons/compressed.gif) | Nobunaga's Ambition (USA).zip | 2026-01-02 14:41 | 245K | |
![[ ]](/icons/compressed.gif) | No Escape (USA).zip | 2026-01-02 14:41 | 958K | |
![[ ]](/icons/compressed.gif) | Nigel Mansell's World Championship Racing (USA).zip | 2026-01-02 14:41 | 485K | |
![[ ]](/icons/compressed.gif) | Nigel Mansell's World Championship Racing (Europe).zip | 2026-01-02 14:41 | 447K | |
![[ ]](/icons/compressed.gif) | NHLPA Hockey 93 (USA, Europe).zip | 2026-01-02 14:41 | 308K | |
![[ ]](/icons/compressed.gif) | NHLPA Hockey 93 (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 308K | |
![[ ]](/icons/compressed.gif) | NHLPA Hockey 93 (USA, Europe) (Rev A) (Beta).zip | 2026-01-02 14:41 | 312K | |
![[ ]](/icons/compressed.gif) | NHL Hockey (USA).zip | 2026-01-02 14:41 | 273K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA).zip | 2026-01-02 14:41 | 945K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-12-01).zip | 2026-01-02 14:41 | 943K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-12-01) (Alt 1).zip | 2026-01-02 14:41 | 946K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-29).zip | 2026-01-02 14:41 | 947K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-28).zip | 2026-01-02 14:41 | 947K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-27).zip | 2026-01-02 14:41 | 946K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-23).zip | 2026-01-02 14:41 | 945K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-22).zip | 2026-01-02 14:41 | 944K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-21).zip | 2026-01-02 14:41 | 944K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-19).zip | 2026-01-02 14:41 | 944K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-09).zip | 2026-01-02 14:41 | 941K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-11-07).zip | 2026-01-02 14:41 | 941K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-10-21).zip | 2026-01-02 14:41 | 941K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-10-01).zip | 2026-01-02 14:41 | 933K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-09-29).zip | 2026-01-02 14:41 | 929K | |
![[ ]](/icons/compressed.gif) | NHL All-Star Hockey 95 (USA) (Beta) (1994-09-14).zip | 2026-01-02 14:41 | 808K | |
![[ ]](/icons/compressed.gif) | NHL 98 (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NHL 97 (USA, Europe).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NHL 96 (USA, Europe).zip | 2026-01-02 14:41 | 920K | |
![[ ]](/icons/compressed.gif) | NHL 95 (USA, Europe).zip | 2026-01-02 14:41 | 918K | |
![[ ]](/icons/compressed.gif) | NHL '94 (USA, Europe).zip | 2026-01-02 14:41 | 565K | |
![[ ]](/icons/compressed.gif) | NFL Sports Talk Football '93 Starring Joe Montana (USA, Europe).zip | 2026-01-02 14:41 | 852K | |
![[ ]](/icons/compressed.gif) | NFL Sports Talk Football '93 Starring Joe Montana (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 841K | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club 96 (USA, Europe).zip | 2026-01-02 14:41 | 1.9M | |
![[ ]](/icons/compressed.gif) | NFL Quarterback Club (World).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | NFL Football '94 Starring Joe Montana (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NFL 98 (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA).zip | 2026-01-02 14:41 | 887K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-11).zip | 2026-01-02 14:41 | 887K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-11) (Alt 1).zip | 2026-01-02 14:41 | 887K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-09).zip | 2026-01-02 14:41 | 886K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-08).zip | 2026-01-02 14:41 | 886K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-07).zip | 2026-01-02 14:41 | 885K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-06).zip | 2026-01-02 14:41 | 885K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-05).zip | 2026-01-02 14:41 | 884K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-05) (Alt 1).zip | 2026-01-02 14:41 | 885K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-04).zip | 2026-01-02 14:41 | 883K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-02).zip | 2026-01-02 14:41 | 885K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-09-01).zip | 2026-01-02 14:41 | 879K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-31).zip | 2026-01-02 14:41 | 890K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-30).zip | 2026-01-02 14:41 | 890K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-22).zip | 2026-01-02 14:41 | 890K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-17).zip | 2026-01-02 14:41 | 864K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-17) (Alt 1).zip | 2026-01-02 14:41 | 864K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-12).zip | 2026-01-02 14:41 | 879K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-12) (Alt 1).zip | 2026-01-02 14:41 | 877K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-10).zip | 2026-01-02 14:41 | 852K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-05).zip | 2026-01-02 14:41 | 632K | |
![[ ]](/icons/compressed.gif) | NFL '95 (USA) (Beta) (1994-08-01).zip | 2026-01-02 14:41 | 625K | |
![[ ]](/icons/compressed.gif) | Newman Haas IndyCar featuring Nigel Mansell (World).zip | 2026-01-02 14:41 | 707K | |
![[ ]](/icons/compressed.gif) | New Horizons (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NCAA Football (USA).zip | 2026-01-02 14:41 | 479K | |
![[ ]](/icons/compressed.gif) | NCAA Final Four Basketball (USA).zip | 2026-01-02 14:41 | 475K | |
![[ ]](/icons/compressed.gif) | NBA Showdown '94 (USA, Europe).zip | 2026-01-02 14:41 | 879K | |
![[ ]](/icons/compressed.gif) | NBA Live 98 (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Live 97 (USA, Europe).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Live 96 (USA, Europe).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | NBA Live 95 (USA, Europe).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | NBA Jam (USA, Europe).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | NBA Jam (USA, Europe) (Rev 1).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | NBA Jam (USA, Europe) (Beta) (April, 1993).zip | 2026-01-02 14:41 | 555K | |
![[ ]](/icons/compressed.gif) | NBA Jam - Tournament Edition (World).zip | 2026-01-02 14:41 | 1.7M | |
![[ ]](/icons/compressed.gif) | NBA Hang Time (USA).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | NBA All-Star Challenge (USA, Europe).zip | 2026-01-02 14:41 | 476K | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-02-01).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-30).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-28).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-28) (Alt 1).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-27).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-27) (Alt 1).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-24).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-22).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-21).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-18).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-15).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-12).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-08).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1995-01-03).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-31).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-30).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-29).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-24).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-22).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-15).zip | 2026-01-02 14:41 | 848K | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-09).zip | 2026-01-02 14:41 | 851K | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-12-02).zip | 2026-01-02 14:41 | 807K | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-11-23).zip | 2026-01-02 14:41 | 651K | |
![[ ]](/icons/compressed.gif) | NBA Action '95 Starring David Robinson (USA, Europe) (Beta) (1994-11-18).zip | 2026-01-02 14:41 | 648K | |
![[ ]](/icons/compressed.gif) | NBA Action '94 (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action (USA) (Beta) (1994-01-16).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | NBA Action (USA) (Beta) (1994-01-04).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mystical Fighter (USA).zip | 2026-01-02 14:41 | 201K | |
![[ ]](/icons/compressed.gif) | Mystic Defender (USA, Europe).zip | 2026-01-02 14:41 | 273K | |
![[ ]](/icons/compressed.gif) | Mystic Defender (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 273K | |
![[ ]](/icons/compressed.gif) | Mystic Defender (USA, Europe) (Beta) (1989-09-14).zip | 2026-01-02 14:41 | 273K | |
![[ ]](/icons/compressed.gif) | Mutant League Hockey (USA, Europe).zip | 2026-01-02 14:41 | 847K | |
![[ ]](/icons/compressed.gif) | Mutant League Football (USA, Europe).zip | 2026-01-02 14:41 | 575K | |
![[ ]](/icons/compressed.gif) | MUSHA - Metallic Uniframe Super Hybrid Armor (USA).zip | 2026-01-02 14:41 | 377K | |
![[ ]](/icons/compressed.gif) | Muhammad Ali Heavyweight Boxing (USA).zip | 2026-01-02 14:41 | 582K | |
![[ ]](/icons/compressed.gif) | Muhammad Ali Heavyweight Boxing (USA) (Beta).zip | 2026-01-02 14:41 | 579K | |
![[ ]](/icons/compressed.gif) | Ms. Pac-Man (USA, Europe).zip | 2026-01-02 14:41 | 70K | |
![[ ]](/icons/compressed.gif) | Mr. Nutz (U).zip | 2026-01-02 14:41 | 728K | |
![[ ]](/icons/compressed.gif) | Mortal Kombat II (World).zip | 2026-01-02 14:41 | 2.2M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat 3 (USA).zip | 2026-01-02 14:41 | 3.2M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat (World).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat (World) (Beta).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mortal Kombat (USA, Europe) (Rev A) (Beta).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Monster World IV (USA, Europe) (En,Ja) (Virtual Console).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Monster World IV (USA) (Genesis Mini).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Monopoly (USA).zip | 2026-01-02 14:41 | 239K | |
![[ ]](/icons/compressed.gif) | Monopoly (USA) (Beta).zip | 2026-01-02 14:41 | 238K | |
![[ ]](/icons/compressed.gif) | Mondu's Fight Palace (USA) (Beta) (1990-07-03).zip | 2026-01-02 14:41 | 405K | |
![[ ]](/icons/compressed.gif) | MLBPA Baseball (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Miracle Piano Teaching System, The (USA).zip | 2026-01-02 14:41 | 234K | |
![[ ]](/icons/compressed.gif) | Minnesota Fats - Pool Legend (USA).zip | 2026-01-02 14:41 | 491K | |
![[ ]](/icons/compressed.gif) | Mike Ditka Power Football (USA, Europe) (Unl).zip | 2026-01-02 14:41 | 536K | |
![[ ]](/icons/compressed.gif) | Mike Ditka Power Football (USA, Europe) (Alt 1) (Unl).zip | 2026-01-02 14:41 | 536K | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers (USA) (Beta) (1994-08-09).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers (USA) (Beta) (1994-08-08).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers (USA) (Beta) (1994-08-04).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers (USA) (Beta) (1994-07-18).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers (USA) (Beta) (1994-07-08).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers - The Movie (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers - The Movie (USA) (Beta) (1995-07-24).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers - The Movie (USA) (Beta) (1995-07-22).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers - The Movie (USA) (Beta) (1995-07-17).zip | 2026-01-02 14:41 | 970K | |
![[ ]](/icons/compressed.gif) | Mighty Morphin Power Rangers - The Movie (USA) (Beta) (1995-07-13).zip | 2026-01-02 14:41 | 966K | |
![[ ]](/icons/compressed.gif) | Might and Magic III - Isles of Terra (USA) (Proto).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Might and Magic - Gates to Another World (USA, Europe).zip | 2026-01-02 14:41 | 533K | |
![[ ]](/icons/compressed.gif) | Mig-29 Fighter Pilot (USA).zip | 2026-01-02 14:41 | 793K | |
![[ ]](/icons/compressed.gif) | Midnight Resistance (USA).zip | 2026-01-02 14:41 | 337K | |
![[ ]](/icons/compressed.gif) | Micro Machines Military - It's a Blast! (U).zip | 2026-01-02 14:41 | 713K | |
![[ ]](/icons/compressed.gif) | Micro Machines 2 - Turbo Tournament (U).zip | 2026-01-02 14:41 | 846K | |
![[ ]](/icons/compressed.gif) | Micro Machines (USA).zip | 2026-01-02 14:41 | 311K | |
![[ ]](/icons/compressed.gif) | Micro Machines - Turbo Tournament 96 (U).zip | 2026-01-02 14:41 | 832K | |
![[ ]](/icons/compressed.gif) | Mickey's Ultimate Challenge (USA).zip | 2026-01-02 14:41 | 430K | |
![[ ]](/icons/compressed.gif) | Mickey Mania - The Timeless Adventures of Mickey Mouse (USA).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Mickey Mania - The Timeless Adventures of Mickey Mouse (USA) (Beta) (September, 1994).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Mickey Mania - The Timeless Adventures of Mickey Mouse (USA) (Beta) (July, 1994).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Mick & Mack as the Global Gladiators (USA).zip | 2026-01-02 14:41 | 660K | |
![[ ]](/icons/compressed.gif) | Mick & Mack as the Global Gladiators (USA) (Beta).zip | 2026-01-02 14:41 | 651K | |
![[ ]](/icons/compressed.gif) | Michael Jackson's Moonwalker (World) (Rev A).zip | 2026-01-02 14:41 | 328K | |
![[ ]](/icons/compressed.gif) | Menacer - 6-Game Cartridge (USA, Europe).zip | 2026-01-02 14:41 | 445K | |
![[ ]](/icons/compressed.gif) | Mega Turrican (USA, Europe) (Virtual Console).zip | 2026-01-02 14:41 | 580K | |
![[ ]](/icons/compressed.gif) | Mega Turrican (USA).zip | 2026-01-02 14:41 | 576K | |
![[ ]](/icons/compressed.gif) | Mega SWIV (U).zip | 2026-01-02 14:41 | 487K | |
![[ ]](/icons/compressed.gif) | Mega Qbert.zip | 2026-01-02 14:41 | 129K | |
![[ ]](/icons/compressed.gif) | Mega Man - The Wily Wars (USA) (Genesis Mini).zip | 2026-01-02 14:41 | 948K | |
![[ ]](/icons/compressed.gif) | Mega Games 6 Vol. 3 (U).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mega Games 6 Vol. 2 (U).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Mega Games 6 Vol. 1 (U).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Mega Games 3 (U).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Mega Games 2 (U).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Mega Bomberman (USA).zip | 2026-01-02 14:41 | 525K | |
![[ ]](/icons/compressed.gif) | McDonald's Treasure Land Adventure (USA).zip | 2026-01-02 14:41 | 732K | |
![[ ]](/icons/compressed.gif) | Mazin Saga - Mutant Fighter (USA).zip | 2026-01-02 14:41 | 671K | |
![[ ]](/icons/compressed.gif) | Math Blaster - Episode 1 (USA).zip | 2026-01-02 14:41 | 482K | |
![[ ]](/icons/compressed.gif) | Master of Monsters (USA).zip | 2026-01-02 14:41 | 301K | |
![[ ]](/icons/compressed.gif) | Mary Shelley's Frankenstein (USA).zip | 2026-01-02 14:41 | 905K | |
![[ ]](/icons/compressed.gif) | Marvel Land (USA).zip | 2026-01-02 14:41 | 476K | |
![[ ]](/icons/compressed.gif) | Marsupilami (USA) (En,Fr,De,Es,It).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Marko (USA).zip | 2026-01-02 14:41 | 802K | |
![[ ]](/icons/compressed.gif) | Mario Lemieux Hockey (USA, Europe).zip | 2026-01-02 14:41 | 260K | |
![[ ]](/icons/compressed.gif) | Mario Andretti Racing (USA, Europe).zip | 2026-01-02 14:41 | 955K | |
![[ ]](/icons/compressed.gif) | Marble Madness (USA, Europe).zip | 2026-01-02 14:41 | 216K | |
![[ ]](/icons/compressed.gif) | Man Overboard! (U).zip | 2026-01-02 14:41 | 377K | |
![[ ]](/icons/compressed.gif) | Mallet Legend's Whac-a-Critter ~ Mallet Legend (USA, Asia) (Unl).zip | 2026-01-02 14:41 | 147K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA).zip | 2026-01-02 14:41 | 563K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-04-28).zip | 2026-01-02 14:41 | 567K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-04-25).zip | 2026-01-02 14:41 | 564K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-04-21).zip | 2026-01-02 14:41 | 563K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-04-11).zip | 2026-01-02 14:41 | 559K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-03-31).zip | 2026-01-02 14:41 | 548K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-03-27).zip | 2026-01-02 14:41 | 537K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-03-14).zip | 2026-01-02 14:41 | 519K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-03-07).zip | 2026-01-02 14:41 | 508K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-02-17).zip | 2026-01-02 14:41 | 476K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-02-02).zip | 2026-01-02 14:41 | 496K | |
![[ ]](/icons/compressed.gif) | Magic School Bus, The - Space Exploration Game (USA) (Beta) (1995-01-12).zip | 2026-01-02 14:41 | 487K | |
![[ ]](/icons/compressed.gif) | Magic Girl featuring Ling Ling the Little Witch (World) (Unl).zip | 2026-01-02 14:41 | 350K | |
![[ ]](/icons/compressed.gif) | Madden NFL 98 (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Madden NFL 97 (USA, Europe).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Madden NFL 96 (USA, Europe).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Madden NFL 95 (USA, Europe).zip | 2026-01-02 14:41 | 921K | |
![[ ]](/icons/compressed.gif) | Madden NFL '94 (USA, Europe).zip | 2026-01-02 14:41 | 906K | |
![[ ]](/icons/compressed.gif) | M-1 Abrams Battle Tank (USA, Europe).zip | 2026-01-02 14:41 | 307K | |
![[ ]](/icons/compressed.gif) | Lufia & the Fortress of Doom (USA) (Proto).zip | 2026-01-02 14:41 | 38K | |
![[ ]](/icons/compressed.gif) | Lotus Turbo Challenge (USA, Europe).zip | 2026-01-02 14:41 | 434K | |
![[ ]](/icons/compressed.gif) | Lotus II (USA, Europe).zip | 2026-01-02 14:41 | 472K | |
![[ ]](/icons/compressed.gif) | Lotus II (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 473K | |
![[ ]](/icons/compressed.gif) | Lost World, The - Jurassic Park (USA, Europe).zip | 2026-01-02 14:41 | 1.9M | |
![[ ]](/icons/compressed.gif) | Lost Vikings, The (USA) (October, 1995).zip | 2026-01-02 14:41 | 688K | |
![[ ]](/icons/compressed.gif) | Lost Vikings, The (USA) (November, 1993).zip | 2026-01-02 14:41 | 684K | |
![[ ]](/icons/compressed.gif) | Lobo (USA) (Proto).zip | 2026-01-02 14:41 | 1.4M | |
![[ ]](/icons/compressed.gif) | Lion King, The (World).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Lion King, The (World) (Steam Version).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Lightening Force - Quest for the Darkstar (USA).zip | 2026-01-02 14:41 | 713K | |
![[ ]](/icons/compressed.gif) | Light Crusader (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Light Crusader (USA) (Beta) (1995-06-08).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Liberty or Death (USA).zip | 2026-01-02 14:41 | 632K | |
![[ ]](/icons/compressed.gif) | LHX Attack Chopper (USA, Europe).zip | 2026-01-02 14:41 | 514K | |
![[ ]](/icons/compressed.gif) | Lethal Enforcers II - Gun Fighters (USA).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Lethal Enforcers (USA).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Lethal Enforcers (USA) (Beta) (1993-08-13).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Lemmings 2 - The Tribes (USA).zip | 2026-01-02 14:41 | 737K | |
![[ ]](/icons/compressed.gif) | Lemmings (Japan, USA, Korea) (Rev A).zip | 2026-01-02 14:41 | 483K | |
![[ ]](/icons/compressed.gif) | Lemmings (Japan, USA).zip | 2026-01-02 14:41 | 481K | |
![[ ]](/icons/compressed.gif) | Legend of Wukong (World) (Unl).zip | 2026-01-02 14:41 | 605K | |
![[ ]](/icons/compressed.gif) | Legend of Galahad, The ~ Galahad (USA, Europe).zip | 2026-01-02 14:41 | 687K | |
![[ ]](/icons/compressed.gif) | Lawnmower Man, The (USA, Europe).zip | 2026-01-02 14:41 | 391K | |
![[ ]](/icons/compressed.gif) | Last Battle (USA, Europe, Korea).zip | 2026-01-02 14:41 | 296K | |
![[ ]](/icons/compressed.gif) | Last Action Hero (USA, Europe).zip | 2026-01-02 14:41 | 329K | |
![[ ]](/icons/compressed.gif) | Landstalker (USA).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Landstalker (USA) (Beta) (1993-02-24).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Landstalker (USA) (1993-07-13) (Sega Channel).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Lakers versus Celtics and the NBA Playoffs (USA, Europe).zip | 2026-01-02 14:41 | 258K | |
![[ ]](/icons/compressed.gif) | La Russa Baseball 95 (USA, Australia).zip | 2026-01-02 14:41 | 883K | |
![[ ]](/icons/compressed.gif) | Krusty's Super Fun House (USA, Europe).zip | 2026-01-02 14:41 | 265K | |
![[ ]](/icons/compressed.gif) | Krusty's Super Fun House (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 265K | |
![[ ]](/icons/compressed.gif) | Klax (USA, Europe) (Tengen).zip | 2026-01-02 14:41 | 108K | |
![[ ]](/icons/compressed.gif) | Klax (USA, Europe) (Tengen) (Beta) (1990-06-21).zip | 2026-01-02 14:41 | 108K | |
![[ ]](/icons/compressed.gif) | King's Bounty - The Conqueror's Quest (USA, Europe).zip | 2026-01-02 14:41 | 245K | |
![[ ]](/icons/compressed.gif) | King Salmon - The Big Catch (USA).zip | 2026-01-02 14:41 | 173K | |
![[ ]](/icons/compressed.gif) | King of the Monsters 2 (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | King of the Monsters (USA).zip | 2026-01-02 14:41 | 585K | |
![[ ]](/icons/compressed.gif) | Kid Chameleon (USA, Europe).zip | 2026-01-02 14:41 | 730K | |
![[ ]](/icons/compressed.gif) | Kid Chameleon (USA, Europe) (Beta) (1991-12-19).zip | 2026-01-02 14:41 | 730K | |
![[ ]](/icons/compressed.gif) | Kick Off 3 - European Challenge (U).zip | 2026-01-02 14:41 | 367K | |
![[ ]](/icons/compressed.gif) | Kawasaki Superbike Challenge (USA, Europe).zip | 2026-01-02 14:41 | 463K | |
![[ ]](/icons/compressed.gif) | Kawasaki Superbike Challenge (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 464K | |
![[ ]](/icons/compressed.gif) | Ka-Ge-Ki - Fists of Steel (USA).zip | 2026-01-02 14:41 | 415K | |
![[ ]](/icons/compressed.gif) | Justice League Task Force (World).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Jurassic Park (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Jurassic Park (USA) (Beta) (June, 1993).zip | 2026-01-02 14:41 | 910K | |
![[ ]](/icons/compressed.gif) | Jurassic Park (USA) (1993-05-26) (Sega Channel).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-07-18).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-07-17).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-07-15).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-07-14).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-07-13).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-07-08).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-06-30).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-06-22).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jurassic Park - Rampage Edition (USA, Europe) (Beta) (1994-06-20).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Jungle Strike (USA, Europe).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Jungle Strike (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Jungle Book, The (USA).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Junction (Japan, USA).zip | 2026-01-02 14:41 | 200K | |
![[ ]](/icons/compressed.gif) | Judge Dredd (World).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Judge Dredd (World) (Beta).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Joystick Test Program.zip | 2026-01-02 14:41 | 2.3K | |
![[ ]](/icons/compressed.gif) | Journey from Darkness - Strider Returns (USA).zip | 2026-01-02 14:41 | 593K | |
![[ ]](/icons/compressed.gif) | Joshua & the Battle of Jericho (USA) (Unl).zip | 2026-01-02 14:41 | 166K | |
![[ ]](/icons/compressed.gif) | Jordan vs Bird (USA, Europe).zip | 2026-01-02 14:41 | 295K | |
![[ ]](/icons/compressed.gif) | Jordan vs Bird (USA, Europe) (Alt 1).zip | 2026-01-02 14:41 | 295K | |
![[ ]](/icons/compressed.gif) | John Madden Football '93 (USA, Europe).zip | 2026-01-02 14:41 | 497K | |
![[ ]](/icons/compressed.gif) | John Madden Football '92 (USA, Europe).zip | 2026-01-02 14:41 | 305K | |
![[ ]](/icons/compressed.gif) | John Madden Football (USA, Europe).zip | 2026-01-02 14:41 | 239K | |
![[ ]](/icons/compressed.gif) | John Madden Football (USA, Europe) (1990-11-07) (Sega Channel).zip | 2026-01-02 14:41 | 239K | |
![[ ]](/icons/compressed.gif) | John Madden Football - Championship Edition (USA).zip | 2026-01-02 14:41 | 498K | |
![[ ]](/icons/compressed.gif) | Joe Montana II Sports Talk Football (World).zip | 2026-01-02 14:41 | 578K | |
![[ ]](/icons/compressed.gif) | Joe Montana II Sports Talk Football (World) (Rev A).zip | 2026-01-02 14:41 | 577K | |
![[ ]](/icons/compressed.gif) | Joe Montana Football (World).zip | 2026-01-02 14:41 | 196K | |
![[ ]](/icons/compressed.gif) | Joe & Mac (USA).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Jimmy White's Whirlwind Snooker (U).zip | 2026-01-02 14:41 | 217K | |
![[ ]](/icons/compressed.gif) | Jim Power - The Arcade Game (USA) (Proto).zip | 2026-01-02 14:41 | 561K | |
![[ ]](/icons/compressed.gif) | Jewel Master (USA, Europe).zip | 2026-01-02 14:41 | 311K | |
![[ ]](/icons/compressed.gif) | Jesse 'The Body' Ventura - Wrestling Superstars (USA) (Proto) (1992-03-02).zip | 2026-01-02 14:41 | 161K | |
![[ ]](/icons/compressed.gif) | Jerry Glanville's Pigskin Footbrawl (USA).zip | 2026-01-02 14:41 | 441K | |
![[ ]](/icons/compressed.gif) | Jeopardy! (USA).zip | 2026-01-02 14:41 | 261K | |
![[ ]](/icons/compressed.gif) | Jeopardy! - Sports Edition (USA).zip | 2026-01-02 14:41 | 296K | |
![[ ]](/icons/compressed.gif) | Jeopardy! - Deluxe Edition (USA).zip | 2026-01-02 14:41 | 326K | |
![[ ]](/icons/compressed.gif) | Jennifer Capriati Tennis (USA).zip | 2026-01-02 14:41 | 198K | |
![[ ]](/icons/compressed.gif) | Jammit (USA).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | James Pond II - Codename - Robocod (USA, Europe).zip | 2026-01-02 14:41 | 287K | |
![[ ]](/icons/compressed.gif) | James Pond 3 (USA, Europe).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | James Pond - Underwater Agent (USA, Europe).zip | 2026-01-02 14:41 | 196K | |
![[ ]](/icons/compressed.gif) | James 'Buster' Douglas Knockout Boxing (USA, Europe).zip | 2026-01-02 14:41 | 209K | |
![[ ]](/icons/compressed.gif) | James Bond 007 - The Duel (USA).zip | 2026-01-02 14:41 | 291K | |
![[ ]](/icons/compressed.gif) | Jack Nicklaus' Power Challenge Golf (USA, Europe).zip | 2026-01-02 14:41 | 608K | |
![[ ]](/icons/compressed.gif) | Izzy's Quest for the Olympic Rings (USA, Europe).zip | 2026-01-02 14:41 | 941K | |
![[ ]](/icons/compressed.gif) | Itchy & Scratchy Game, The (USA) (Proto).zip | 2026-01-02 14:41 | 506K | |
![[ ]](/icons/compressed.gif) | It Came from the Desert (USA) (Proto).zip | 2026-01-02 14:41 | 289K | |
![[ ]](/icons/compressed.gif) | Ishido - The Way of Stones (USA) (Unl).zip | 2026-01-02 14:41 | 60K | |
![[ ]](/icons/compressed.gif) | International Superstar Soccer Deluxe (U).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | International Rugby (U).zip | 2026-01-02 14:41 | 246K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA).zip | 2026-01-02 14:41 | 607K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (July, 1992).zip | 2026-01-02 14:41 | 663K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1994-01-27).zip | 2026-01-02 14:41 | 610K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1994-01-26).zip | 2026-01-02 14:41 | 610K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1994-01-03).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1994-01-01).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1993-12-29).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1993-12-28).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1993-12-28) (Alt 1).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Instruments of Chaos Starring Young Indiana Jones (USA) (Beta) (1993-09-23).zip | 2026-01-02 14:41 | 611K | |
![[ ]](/icons/compressed.gif) | Insector X (USA).zip | 2026-01-02 14:41 | 215K | |
![[ ]](/icons/compressed.gif) | Indiana Jones and the Last Crusade (USA).zip | 2026-01-02 14:41 | 479K | |
![[ ]](/icons/compressed.gif) | Incredible Hulk, The (USA, Europe).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Incredible Crash Dummies, The (USA, Europe).zip | 2026-01-02 14:41 | 528K | |
![[ ]](/icons/compressed.gif) | Incredible Crash Dummies, The (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 550K | |
![[ ]](/icons/compressed.gif) | Immortal, The (USA, Europe).zip | 2026-01-02 14:41 | 741K | |
![[ ]](/icons/compressed.gif) | IMG International Tour Tennis (USA, Europe).zip | 2026-01-02 14:41 | 702K | |
![[ ]](/icons/compressed.gif) | Hurricanes (U).zip | 2026-01-02 14:41 | 848K | |
![[ ]](/icons/compressed.gif) | Humans, The (USA).zip | 2026-01-02 14:41 | 702K | |
![[ ]](/icons/compressed.gif) | Hook (USA).zip | 2026-01-02 14:41 | 410K | |
![[ ]](/icons/compressed.gif) | Home Alone 2 - Lost in New York (USA).zip | 2026-01-02 14:41 | 370K | |
![[ ]](/icons/compressed.gif) | Home Alone 2 - Lost in New York (USA) (1993-09-29) (Sega Channel).zip | 2026-01-02 14:41 | 511K | |
![[ ]](/icons/compressed.gif) | Home Alone (USA, Europe).zip | 2026-01-02 14:41 | 323K | |
![[ ]](/icons/compressed.gif) | Home Alone (USA, Europe) (Beta) (July, 1992).zip | 2026-01-02 14:41 | 324K | |
![[ ]](/icons/compressed.gif) | Hit the Ice - VHL - The Official Video Hockey League (USA).zip | 2026-01-02 14:41 | 241K | |
![[ ]](/icons/compressed.gif) | High Seas Havoc (USA).zip | 2026-01-02 14:41 | 646K | |
![[ ]](/icons/compressed.gif) | High Seas Havoc (USA) (Beta).zip | 2026-01-02 14:41 | 467K | |
![[ ]](/icons/compressed.gif) | Herzog Zwei (USA, Europe).zip | 2026-01-02 14:41 | 307K | |
![[ ]](/icons/compressed.gif) | Hellfire (USA).zip | 2026-01-02 14:41 | 199K | |
![[ ]](/icons/compressed.gif) | Heavy Nova (USA).zip | 2026-01-02 14:41 | 546K | |
![[ ]](/icons/compressed.gif) | Head-On Soccer (USA).zip | 2026-01-02 14:41 | 702K | |
![[ ]](/icons/compressed.gif) | Haunting Starring Polterguy (USA, Europe).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Hardwired (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 839K | |
![[ ]](/icons/compressed.gif) | HardBall! (USA, Europe) (Unl).zip | 2026-01-02 14:41 | 442K | |
![[ ]](/icons/compressed.gif) | HardBall '95 (USA).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | HardBall '94 (USA, Europe).zip | 2026-01-02 14:41 | 888K | |
![[ ]](/icons/compressed.gif) | Hard Drivin' (World).zip | 2026-01-02 14:41 | 91K | |
![[ ]](/icons/compressed.gif) | Gunstar Heroes (USA).zip | 2026-01-02 14:41 | 646K | |
![[ ]](/icons/compressed.gif) | Gunship (U).zip | 2026-01-02 14:41 | 589K | |
![[ ]](/icons/compressed.gif) | Growl (USA).zip | 2026-01-02 14:41 | 262K | |
![[ ]](/icons/compressed.gif) | Growl (USA) (Beta) (1991-08-26).zip | 2026-01-02 14:41 | 265K | |
![[ ]](/icons/compressed.gif) | Grind Stormer (USA).zip | 2026-01-02 14:41 | 487K | |
![[ ]](/icons/compressed.gif) | Greendog - The Beached Surfer Dude! (USA, Europe).zip | 2026-01-02 14:41 | 386K | |
![[ ]](/icons/compressed.gif) | Greatest Heavyweights (USA).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Great Waldo Search, The (USA).zip | 2026-01-02 14:41 | 308K | |
![[ ]](/icons/compressed.gif) | Great Circus Mystery Starring Mickey & Minnie, The (USA).zip | 2026-01-02 14:41 | 798K | |
![[ ]](/icons/compressed.gif) | Granada (Japan, USA).zip | 2026-01-02 14:41 | 298K | |
![[ ]](/icons/compressed.gif) | Granada (Japan, USA) (Rev A).zip | 2026-01-02 14:41 | 298K | |
![[ ]](/icons/compressed.gif) | Granada (Japan, USA) (Rev A) (Beta).zip | 2026-01-02 14:41 | 297K | |
![[ ]](/icons/compressed.gif) | Goofy's Hysterical History Tour (USA).zip | 2026-01-02 14:41 | 495K | |
![[ ]](/icons/compressed.gif) | Golden Axe III.zip | 2026-01-02 14:41 | 680K | |
![[ ]](/icons/compressed.gif) | Golden Axe II (World).zip | 2026-01-02 14:41 | 327K | |
![[ ]](/icons/compressed.gif) | Golden Axe II (World) (Beta).zip | 2026-01-02 14:41 | 325K | |
![[ ]](/icons/compressed.gif) | Golden Axe (World).zip | 2026-01-02 14:41 | 339K | |
![[ ]](/icons/compressed.gif) | Golden Axe (World) (Rev B) (Sega Smash Pack).zip | 2026-01-02 14:41 | 340K | |
![[ ]](/icons/compressed.gif) | Golden Axe (World) (Rev A).zip | 2026-01-02 14:41 | 339K | |
![[ ]](/icons/compressed.gif) | Golden Axe (World) (Beta) (1989-11-22).zip | 2026-01-02 14:41 | 339K | |
![[ ]](/icons/compressed.gif) | Golden Axe (World) (Beta) (1989-10-14).zip | 2026-01-02 14:41 | 339K | |
![[ ]](/icons/compressed.gif) | Gods (USA).zip | 2026-01-02 14:41 | 434K | |
![[ ]](/icons/compressed.gif) | Gods (USA) (Beta).zip | 2026-01-02 14:41 | 434K | |
![[ ]](/icons/compressed.gif) | G-LOC - Air Battle (World).zip | 2026-01-02 14:41 | 490K | |
![[ ]](/icons/compressed.gif) | G-LOC - Air Battle (World) (Beta).zip | 2026-01-02 14:41 | 469K | |
![[ ]](/icons/compressed.gif) | G-LOC - Air Battle (World) (1992-11-23) (Sega Channel).zip | 2026-01-02 14:41 | 490K | |
![[ ]](/icons/compressed.gif) | Ghostbusters (USA, Europe).zip | 2026-01-02 14:41 | 350K | |
![[ ]](/icons/compressed.gif) | Ghostbusters (USA, Europe) (Rev A) (Beta) (1990-05-01).zip | 2026-01-02 14:41 | 351K | |
![[ ]](/icons/compressed.gif) | George Foreman's KO Boxing (USA).zip | 2026-01-02 14:41 | 629K | |
![[ ]](/icons/compressed.gif) | Genghis Khan II - Clan of the Gray Wolf (USA).zip | 2026-01-02 14:41 | 510K | |
![[ ]](/icons/compressed.gif) | Generations Lost (USA, Europe).zip | 2026-01-02 14:41 | 621K | |
![[ ]](/icons/compressed.gif) | Generals of the Yang Family (World) (Unl).zip | 2026-01-02 14:41 | 654K | |
![[ ]](/icons/compressed.gif) | General Chaos (USA, Europe).zip | 2026-01-02 14:41 | 499K | |
![[ ]](/icons/compressed.gif) | GEMS (USA) (v2.8) (Beta) (1994-06-04) (Program).zip | 2026-01-02 14:41 | 10K | |
![[ ]](/icons/compressed.gif) | Gemfire (USA).zip | 2026-01-02 14:41 | 408K | |
![[ ]](/icons/compressed.gif) | Gauntlet IV (USA, Europe).zip | 2026-01-02 14:41 | 529K | |
![[ ]](/icons/compressed.gif) | Gauntlet IV (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 529K | |
![[ ]](/icons/compressed.gif) | Garry Kitchen's Super Battletank - War in the Gulf (USA).zip | 2026-01-02 14:41 | 287K | |
![[ ]](/icons/compressed.gif) | Gargoyles (USA).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Garfield - Caught in the Act (USA, Europe).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Game Genie (USA, Europe) (Rev A) (Program).zip | 2026-01-02 14:41 | 11K | |
![[ ]](/icons/compressed.gif) | Game Genie (USA, Europe) (Program).zip | 2026-01-02 14:41 | 12K | |
![[ ]](/icons/compressed.gif) | Galaxy Force II (World) (Rev B).zip | 2026-01-02 14:41 | 423K | |
![[ ]](/icons/compressed.gif) | Galaxy Force II (USA, Europe) (Steam Version).zip | 2026-01-02 14:41 | 423K | |
![[ ]](/icons/compressed.gif) | Gain Ground (USA).zip | 2026-01-02 14:41 | 356K | |
![[ ]](/icons/compressed.gif) | Gain Ground (USA) (Beta) (1990-07-27).zip | 2026-01-02 14:41 | 329K | |
![[ ]](/icons/compressed.gif) | Gaiares (Japan, USA).zip | 2026-01-02 14:41 | 593K | |
![[ ]](/icons/compressed.gif) | Gadget Twins (USA).zip | 2026-01-02 14:41 | 395K | |
![[ ]](/icons/compressed.gif) | FZ Senki Axis ~ Final Zone (Japan, USA).zip | 2026-01-02 14:41 | 275K | |
![[ ]](/icons/compressed.gif) | Funny World & Balloon Boy (USA) (Unl).zip | 2026-01-02 14:41 | 182K | |
![[ ]](/icons/compressed.gif) | Fun 'n' Games (USA).zip | 2026-01-02 14:41 | 549K | |
![[ ]](/icons/compressed.gif) | Fun Car Rally (USA) (Proto).zip | 2026-01-02 14:41 | 232K | |
![[ ]](/icons/compressed.gif) | Frogger (USA).zip | 2026-01-02 14:41 | 28K | |
![[ ]](/icons/compressed.gif) | Frogger (USA) (Rev 1).zip | 2026-01-02 14:41 | 28K | |
![[ ]](/icons/compressed.gif) | Frank Thomas Big Hurt Baseball (USA, Europe).zip | 2026-01-02 14:41 | 1.8M | |
![[ ]](/icons/compressed.gif) | Formula One (USA).zip | 2026-01-02 14:41 | 440K | |
![[ ]](/icons/compressed.gif) | Forgotten Worlds (World).zip | 2026-01-02 14:41 | 377K | |
![[ ]](/icons/compressed.gif) | Forgotten Worlds (World) (Rev A).zip | 2026-01-02 14:41 | 377K | |
![[ ]](/icons/compressed.gif) | Foreman for Real (World).zip | 2026-01-02 14:41 | 800K | |
![[ ]](/icons/compressed.gif) | Flintstones, The (USA) (Taito).zip | 2026-01-02 14:41 | 319K | |
![[ ]](/icons/compressed.gif) | Flintstones, The (USA) (Proto) (Ocean).zip | 2026-01-02 14:41 | 416K | |
![[ ]](/icons/compressed.gif) | Flintstones, The (USA) (Beta) (1992-11-05) (Taito).zip | 2026-01-02 14:41 | 320K | |
![[ ]](/icons/compressed.gif) | Flink (U).zip | 2026-01-02 14:41 | 772K | |
![[ ]](/icons/compressed.gif) | Flicky (USA, Europe).zip | 2026-01-02 14:41 | 42K | |
![[ ]](/icons/compressed.gif) | Flashback - The Quest for Identity (USA) (En,Fr).zip | 2026-01-02 14:41 | 961K | |
![[ ]](/icons/compressed.gif) | Fix It Felix Jr..zip | 2026-01-02 14:41 | 17K | |
![[ ]](/icons/compressed.gif) | Fire Shark (USA).zip | 2026-01-02 14:41 | 193K | |
![[ ]](/icons/compressed.gif) | Fighting Masters (USA).zip | 2026-01-02 14:41 | 223K | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 97 (USA, Europe) (En,Fr,De,Es,It,Sv).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 96 (USA, Europe) (En,Fr,De,Es,It,Sv).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | FIFA Soccer 95 (USA, Europe) (En,Fr,De,Es).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | FIFA International Soccer (USA, Europe) (En,Fr,De,Es).zip | 2026-01-02 14:41 | 963K | |
![[ ]](/icons/compressed.gif) | FIFA 98 - Road to World Cup (U).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | FIFA 98 - Road to World Cup (Europe) (En,Fr,Es,It,Sv).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Fido Dido (USA) (Proto).zip | 2026-01-02 14:41 | 461K | |
![[ ]](/icons/compressed.gif) | Ferrari Grand Prix Challenge (USA).zip | 2026-01-02 14:41 | 402K | |
![[ ]](/icons/compressed.gif) | Fatal Rewind (USA, Europe).zip | 2026-01-02 14:41 | 228K | |
![[ ]](/icons/compressed.gif) | Fatal Labyrinth (USA, Europe).zip | 2026-01-02 14:41 | 101K | |
![[ ]](/icons/compressed.gif) | Fatal Fury 2 (USA, Korea).zip | 2026-01-02 14:41 | 1.7M | |
![[ ]](/icons/compressed.gif) | Fatal Fury (USA).zip | 2026-01-02 14:41 | 823K | |
![[ ]](/icons/compressed.gif) | Fantastic Dizzy (USA, Europe) (En,Fr,De,Es,It).zip | 2026-01-02 14:41 | 397K | |
![[ ]](/icons/compressed.gif) | Fantastic Dizzy (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 290K | |
![[ ]](/icons/compressed.gif) | Fantasia (World).zip | 2026-01-02 14:41 | 275K | |
![[ ]](/icons/compressed.gif) | Fantasia (World) (Rev A).zip | 2026-01-02 14:41 | 275K | |
![[ ]](/icons/compressed.gif) | Fantasia (World) (1991-06-17) (Sega Channel).zip | 2026-01-02 14:41 | 276K | |
![[ ]](/icons/compressed.gif) | Family Feud (USA).zip | 2026-01-02 14:41 | 308K | |
![[ ]](/icons/compressed.gif) | Faery Tale Adventure, The (USA, Europe).zip | 2026-01-02 14:41 | 275K | |
![[ ]](/icons/compressed.gif) | F-117 Night Storm (USA, Europe).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | F-22 Interceptor (USA) (Beta).zip | 2026-01-02 14:41 | 377K | |
![[ ]](/icons/compressed.gif) | F-22 Interceptor (USA) (1991-09-17) (Sega Channel).zip | 2026-01-02 14:41 | 400K | |
![[ ]](/icons/compressed.gif) | F-22 Interceptor - Advanced Tactical Fighter (USA, Europe) (F-202).zip | 2026-01-02 14:41 | 375K | |
![[ ]](/icons/compressed.gif) | F-22 Interceptor - Advanced Tactical Fighter (USA) (F-205).zip | 2026-01-02 14:41 | 377K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle II (USA).zip | 2026-01-02 14:41 | 420K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle II (USA) (Sample).zip | 2026-01-02 14:41 | 841K | |
![[ ]](/icons/compressed.gif) | F-15 Strike Eagle II (USA) (Beta) (1992-07-13).zip | 2026-01-02 14:41 | 283K | |
![[ ]](/icons/compressed.gif) | F1 World Championship (U).zip | 2026-01-02 14:41 | 682K | |
![[ ]](/icons/compressed.gif) | F1 Circus MD (USA) (Proto) (1991-12-28) (Sega Channel).zip | 2026-01-02 14:41 | 323K | |
![[ ]](/icons/compressed.gif) | F1 - World Championship Edition (USA) (Proto 2).zip | 2026-01-02 14:41 | 674K | |
![[ ]](/icons/compressed.gif) | F1 - World Championship Edition (USA) (Proto 1).zip | 2026-01-02 14:41 | 595K | |
![[ ]](/icons/compressed.gif) | Exodus - Journey to the Promised Land (USA) (Unl).zip | 2026-01-02 14:41 | 391K | |
![[ ]](/icons/compressed.gif) | Exo Squad (USA).zip | 2026-01-02 14:41 | 743K | |
![[ ]](/icons/compressed.gif) | Exo Squad (USA) (Beta).zip | 2026-01-02 14:41 | 732K | |
![[ ]](/icons/compressed.gif) | Ex-Mutants (USA, Europe).zip | 2026-01-02 14:41 | 545K | |
![[ ]](/icons/compressed.gif) | Exile (USA).zip | 2026-01-02 14:41 | 784K | |
![[ ]](/icons/compressed.gif) | Exile (USA) (Sega Channel).zip | 2026-01-02 14:41 | 784K | |
![[ ]](/icons/compressed.gif) | Evander Holyfield's 'Real Deal' Boxing (World).zip | 2026-01-02 14:41 | 343K | |
![[ ]](/icons/compressed.gif) | European Club Soccer (U).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Eternal Champions (USA).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | ESWAT - City under Siege (USA, Europe) (Rev A).zip | 2026-01-02 14:41 | 366K | |
![[ ]](/icons/compressed.gif) | ESPN Sunday Night NFL (USA).zip | 2026-01-02 14:41 | 909K | |
![[ ]](/icons/compressed.gif) | ESPN Sunday Night NFL (USA) (Beta).zip | 2026-01-02 14:41 | 962K | |
![[ ]](/icons/compressed.gif) | ESPN Speed World (USA).zip | 2026-01-02 14:41 | 943K | |
![[ ]](/icons/compressed.gif) | ESPN Speed World (USA) (Beta).zip | 2026-01-02 14:41 | 944K | |
![[ ]](/icons/compressed.gif) | ESPN National Hockey Night (USA).zip | 2026-01-02 14:41 | 858K | |
![[ ]](/icons/compressed.gif) | ESPN National Hockey Night (USA) (Beta).zip | 2026-01-02 14:41 | 858K | |
![[ ]](/icons/compressed.gif) | ESPN Baseball Tonight (USA).zip | 2026-01-02 14:41 | 965K | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-06-20).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-06-18).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-06-14).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-06-10).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-06-07).zip | 2026-01-02 14:41 | 966K | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-06-02).zip | 2026-01-02 14:41 | 744K | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-05-23).zip | 2026-01-02 14:41 | 484K | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-05-18).zip | 2026-01-02 14:41 | 329K | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-05-09).zip | 2026-01-02 14:41 | 918K | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-04-18).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Escape from Mars Starring Taz (USA) (Beta) (1994-03-09).zip | 2026-01-02 14:41 | 906K | |
![[ ]](/icons/compressed.gif) | Elemental Master (USA).zip | 2026-01-02 14:41 | 397K | |
![[ ]](/icons/compressed.gif) | El.Viento (USA).zip | 2026-01-02 14:41 | 668K | |
![[ ]](/icons/compressed.gif) | Ecco the Dolphin (USA, Europe, Korea).zip | 2026-01-02 14:41 | 504K | |
![[ ]](/icons/compressed.gif) | Ecco the Dolphin (USA, Europe, Korea) (Rev A) (Beta) (1993-06-29).zip | 2026-01-02 14:41 | 514K | |
![[ ]](/icons/compressed.gif) | Ecco Jr. (USA, Australia).zip | 2026-01-02 14:41 | 498K | |
![[ ]](/icons/compressed.gif) | Ecco Jr. (USA, Australia) (Beta).zip | 2026-01-02 14:41 | 497K | |
![[ ]](/icons/compressed.gif) | Ecco - The Tides of Time (USA).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Ecco - The Tides of Time (USA) (Beta) (March, 1994).zip | 2026-01-02 14:41 | 854K | |
![[ ]](/icons/compressed.gif) | Ecco - The Tides of Time (USA) (Beta) (1994-04-29).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Ecco - The Tides of Time (USA) (Beta) (1994-04-13).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Earthworm Jim 2 (USA).zip | 2026-01-02 14:41 | 1.7M | |
![[ ]](/icons/compressed.gif) | Earthworm Jim (USA).zip | 2026-01-02 14:41 | 1.8M | |
![[ ]](/icons/compressed.gif) | Earthworm Jim (USA) (Beta) (1994-07-28).zip | 2026-01-02 14:41 | 1.8M | |
![[ ]](/icons/compressed.gif) | Earth Defense ~ Earth Defend, The (USA, Asia) (Unl).zip | 2026-01-02 14:41 | 204K | |
![[ ]](/icons/compressed.gif) | Earnest Evans (USA).zip | 2026-01-02 14:41 | 535K | |
![[ ]](/icons/compressed.gif) | Earnest Evans (USA) (Beta).zip | 2026-01-02 14:41 | 549K | |
![[ ]](/icons/compressed.gif) | EA Sports Double Header - EA Hockey & John Madden Football (U).zip | 2026-01-02 14:41 | 514K | |
![[ ]](/icons/compressed.gif) | DynoBlaze (USA) (Proto).zip | 2026-01-02 14:41 | 657K | |
![[ ]](/icons/compressed.gif) | Dynamite Headdy (USA, Europe).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Dynamite Headdy (USA, Europe) (Beta) (1994-06-22).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Dynamite Duke (World).zip | 2026-01-02 14:41 | 347K | |
![[ ]](/icons/compressed.gif) | Dynamite Duke (World) (Rev A).zip | 2026-01-02 14:41 | 347K | |
![[ ]](/icons/compressed.gif) | Dynamite Duke (World) (Beta) (1990-06-21).zip | 2026-01-02 14:41 | 347K | |
![[ ]](/icons/compressed.gif) | Dungeons & Dragons - Warriors of the Eternal Sun (USA, Europe).zip | 2026-01-02 14:41 | 511K | |
![[ ]](/icons/compressed.gif) | Dune - The Battle for Arrakis (USA).zip | 2026-01-02 14:41 | 587K | |
![[ ]](/icons/compressed.gif) | Dragon's Revenge (USA, Europe).zip | 2026-01-02 14:41 | 709K | |
![[ ]](/icons/compressed.gif) | Dragon's Lair (USA) (Proto) (June, 1994).zip | 2026-01-02 14:41 | 316K | |
![[ ]](/icons/compressed.gif) | Dragon's Fury (USA, Europe).zip | 2026-01-02 14:41 | 364K | |
![[ ]](/icons/compressed.gif) | Dragon Ball Final Bout (Pirate).zip | 2026-01-02 14:41 | 1.4M | |
![[ ]](/icons/compressed.gif) | Dragon - The Bruce Lee Story (USA).zip | 2026-01-02 14:41 | 1.4M | |
![[ ]](/icons/compressed.gif) | Dr. Robotnik's Mean Bean Machine (USA).zip | 2026-01-02 14:41 | 557K | |
![[ ]](/icons/compressed.gif) | Dr. Robotnik's Mean Bean Machine (USA) (Beta).zip | 2026-01-02 14:41 | 565K | |
![[ ]](/icons/compressed.gif) | Double Dribble - The Playoff Edition (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Double Dragon V - The Shadow Falls (USA).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Double Dragon 3 - The Arcade Game (USA, Europe).zip | 2026-01-02 14:41 | 459K | |
![[ ]](/icons/compressed.gif) | Double Dragon (USA, Europe) (Unl).zip | 2026-01-02 14:41 | 238K | |
![[ ]](/icons/compressed.gif) | Double Clutch (U).zip | 2026-01-02 14:41 | 169K | |
![[ ]](/icons/compressed.gif) | Doom Troopers (USA).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Donald in Maui Mallard (U).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Dominus (USA) (Proto).zip | 2026-01-02 14:41 | 554K | |
![[ ]](/icons/compressed.gif) | DJ Boy (USA).zip | 2026-01-02 14:41 | 219K | |
![[ ]](/icons/compressed.gif) | Dinosaur's Tale, A (USA).zip | 2026-01-02 14:41 | 488K | |
![[ ]](/icons/compressed.gif) | Dino Land (USA).zip | 2026-01-02 14:41 | 257K | |
![[ ]](/icons/compressed.gif) | Dino Dini's Soccer (U).zip | 2026-01-02 14:41 | 408K | |
![[ ]](/icons/compressed.gif) | Dick Vitale's 'Awesome, Baby!' College Hoops (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | Dick Tracy (World).zip | 2026-01-02 14:41 | 349K | |
![[ ]](/icons/compressed.gif) | Dexstar (USA, Europe) (Beta) (1994-08-26).zip | 2026-01-02 14:41 | 1.4M | |
![[ ]](/icons/compressed.gif) | Dexstar (USA, Europe) (Beta) (1994-08-12).zip | 2026-01-02 14:41 | 1.4M | |
![[ ]](/icons/compressed.gif) | Devilish (USA) (Beta) (1992-01-16).zip | 2026-01-02 14:41 | 319K | |
![[ ]](/icons/compressed.gif) | Devilish - The Next Possession (USA).zip | 2026-01-02 14:41 | 319K | |
![[ ]](/icons/compressed.gif) | Desert Strike - Return to the Gulf (USA, Europe).zip | 2026-01-02 14:41 | 568K | |
![[ ]](/icons/compressed.gif) | Desert Demolition Starring Road Runner and Wile E. Coyote (USA, Europe).zip | 2026-01-02 14:41 | 593K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-19).zip | 2026-01-02 14:41 | 597K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-16).zip | 2026-01-02 14:41 | 597K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-15).zip | 2026-01-02 14:41 | 597K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-14).zip | 2026-01-02 14:41 | 596K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-13).zip | 2026-01-02 14:41 | 597K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-12).zip | 2026-01-02 14:41 | 640K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-12) (Alt 1).zip | 2026-01-02 14:41 | 618K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-08).zip | 2026-01-02 14:41 | 599K | |
![[ ]](/icons/compressed.gif) | Desert Demolition (USA, Europe) (Beta) (1994-12-06).zip | 2026-01-02 14:41 | 621K | |
![[ ]](/icons/compressed.gif) | Demolition Man (USA, Europe).zip | 2026-01-02 14:41 | 809K | |
![[ ]](/icons/compressed.gif) | Demolition Man (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 807K | |
![[ ]](/icons/compressed.gif) | DEcapAttack (USA, Europe, Korea).zip | 2026-01-02 14:41 | 246K | |
![[ ]](/icons/compressed.gif) | Death Duel (USA).zip | 2026-01-02 14:41 | 504K | |
![[ ]](/icons/compressed.gif) | Death Duel (USA) (Beta) (1992-05-06).zip | 2026-01-02 14:41 | 509K | |
![[ ]](/icons/compressed.gif) | Death and Return of Superman, The (USA).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | Deadly Moves (USA).zip | 2026-01-02 14:41 | 554K | |
![[ ]](/icons/compressed.gif) | Daze Before Christmas (U).zip | 2026-01-02 14:41 | 1.2M | |
![[ ]](/icons/compressed.gif) | Davis Cup Tennis ~ Davis Cup World Tour (USA, Europe).zip | 2026-01-02 14:41 | 534K | |
![[ ]](/icons/compressed.gif) | Davis Cup Tennis ~ Davis Cup World Tour (USA, Europe) (Beta) (June, 1993).zip | 2026-01-02 14:41 | 537K | |
![[ ]](/icons/compressed.gif) | Davis Cup II (USA) (Proto) (1994-07-28).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | David Robinson's Supreme Court (USA, Europe).zip | 2026-01-02 14:41 | 254K | |
![[ ]](/icons/compressed.gif) | David Crane's Amazing Tennis (USA).zip | 2026-01-02 14:41 | 383K | |
![[ ]](/icons/compressed.gif) | Dashin' Desperadoes (USA).zip | 2026-01-02 14:41 | 627K | |
![[ ]](/icons/compressed.gif) | Dashin' Desperadoes (USA) (Beta).zip | 2026-01-02 14:41 | 597K | |
![[ ]](/icons/compressed.gif) | Dark Castle (USA, Europe).zip | 2026-01-02 14:41 | 383K | |
![[ ]](/icons/compressed.gif) | Darius (World) (Genesis Mini, Mega Drive Mini).zip | 2026-01-02 14:41 | 1.4M | |
![[ ]](/icons/compressed.gif) | Danny Sullivan's Indy Heat (USA) (Proto).zip | 2026-01-02 14:41 | 284K | |
![[ ]](/icons/compressed.gif) | Daimakaimura ~ Ghouls'n Ghosts (World).zip | 2026-01-02 14:41 | 432K | |
![[ ]](/icons/compressed.gif) | Daimakaimura ~ Ghouls'n Ghosts (World) (Rev A).zip | 2026-01-02 14:41 | 432K | |
![[ ]](/icons/compressed.gif) | Daimakaimura ~ Ghouls'n Ghosts (World) (Rev A) (Sega Channel).zip | 2026-01-02 14:41 | 433K | |
![[ ]](/icons/compressed.gif) | Daffy Duck in Hollywood (U).zip | 2026-01-02 14:41 | 939K | |
![[ ]](/icons/compressed.gif) | Cyborg Justice (USA, Europe).zip | 2026-01-02 14:41 | 243K | |
![[ ]](/icons/compressed.gif) | Cyborg Justice (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 229K | |
![[ ]](/icons/compressed.gif) | Cyber-Cop (USA).zip | 2026-01-02 14:41 | 288K | |
![[ ]](/icons/compressed.gif) | Cyberball (World).zip | 2026-01-02 14:41 | 290K | |
![[ ]](/icons/compressed.gif) | CutThroat Island (USA, Europe).zip | 2026-01-02 14:41 | 865K | |
![[ ]](/icons/compressed.gif) | CutThroat Island (USA, Europe) (Beta).zip | 2026-01-02 14:41 | 864K | |
![[ ]](/icons/compressed.gif) | Curse (USA) (Proto) (1990-06-26) (Sega Channel).zip | 2026-01-02 14:41 | 184K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA).zip | 2026-01-02 14:41 | 463K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-07-13).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-07-12).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-07-12) (Alt 1).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-07-03).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-07-02).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-07-01).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-06-30).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-06-28).zip | 2026-01-02 14:41 | 463K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-06-23).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-06-10).zip | 2026-01-02 14:41 | 462K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-06-06).zip | 2026-01-02 14:41 | 456K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-06-01).zip | 2026-01-02 14:41 | 456K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-05-26).zip | 2026-01-02 14:41 | 458K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-05-19).zip | 2026-01-02 14:41 | 455K | |
![[ ]](/icons/compressed.gif) | Crystal's Pony Tale (USA) (Beta) (1994-05-11).zip | 2026-01-02 14:41 | 456K | |
![[ ]](/icons/compressed.gif) | Crusader of Centy (USA).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Crue Ball - Heavy Metal Pinball (USA, Europe).zip | 2026-01-02 14:41 | 211K | |
![[ ]](/icons/compressed.gif) | CrossFire (USA).zip | 2026-01-02 14:41 | 217K | |
![[ ]](/icons/compressed.gif) | CrossFire (USA) (Sample).zip | 2026-01-02 14:41 | 236K | |
![[ ]](/icons/compressed.gif) | Crack Down (USA).zip | 2026-01-02 14:41 | 221K | |
![[ ]](/icons/compressed.gif) | Cosmic Spacehead (USA, Europe) (En,Fr,De,Es).zip | 2026-01-02 14:41 | 654K | |
![[ ]](/icons/compressed.gif) | Cool Spot (USA).zip | 2026-01-02 14:41 | 618K | |
![[ ]](/icons/compressed.gif) | Cool Spot (USA) (Beta).zip | 2026-01-02 14:41 | 618K | |
![[ ]](/icons/compressed.gif) | Contra - Hard Corps (USA, Korea).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Congo - The Game (USA) (Proto).zip | 2026-01-02 14:41 | 505K | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Virtual Console).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Sega Smash Pack).zip | 2026-01-02 14:41 | 1.5M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Demo) (1995-06-12) (Sega Channel).zip | 2026-01-02 14:41 | 1.3M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-03).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-02).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-02) (Alt 1).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-01).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-01) (Alt 3).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-01) (Alt 2).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-06-01) (Alt 1).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-05-30).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-05-26).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Comix Zone (USA) (Beta) (1995-04-04).zip | 2026-01-02 14:41 | 1.6M | |
![[ ]](/icons/compressed.gif) | Combat Cars (USA, Europe).zip | 2026-01-02 14:41 | 505K | |
![[ ]](/icons/compressed.gif) | Combat Aces (USA) (Proto) (Unl).zip | 2026-01-02 14:41 | 61K | |
![[ ]](/icons/compressed.gif) | Columns III (USA).zip | 2026-01-02 14:41 | 240K | |
![[ ]](/icons/compressed.gif) | Columns (USA, Europe).zip | 2026-01-02 14:41 | 82K | |
![[ ]](/icons/compressed.gif) | Columns (USA, Europe) (1990-06-21) (Sega Channel).zip | 2026-01-02 14:41 | 82K | |
![[ ]](/icons/compressed.gif) | College Slam (USA).zip | 2026-01-02 14:41 | 2.1M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship II (USA).zip | 2026-01-02 14:41 | 761K | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-20).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-18).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-15).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-14).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-08).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-07).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-03).zip | 2026-01-02 14:41 | 1.1M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-06-01).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-31).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-25).zip | 2026-01-02 14:41 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-20).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-17).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-11).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-06).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-05-03).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-04-29).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-04-19).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-04-18).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football's National Championship (USA) (Beta) (1994-04-13).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football USA 97 (USA).zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | College Football USA 96 (USA).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | College Football USA 96 (USA) (Beta) (1995-06-21).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | Coach K College Basketball (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Clue (USA).zip | 2026-01-02 14:40 | 328K | |
![[ ]](/icons/compressed.gif) | Cliffhanger (USA).zip | 2026-01-02 14:40 | 536K | |
![[ ]](/icons/compressed.gif) | ClayFighter (USA).zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | Chuck Rock II - Son of Chuck (USA).zip | 2026-01-02 14:40 | 543K | |
![[ ]](/icons/compressed.gif) | Chuck Rock II - Son of Chuck (USA) (Beta).zip | 2026-01-02 14:40 | 544K | |
![[ ]](/icons/compressed.gif) | Chuck Rock (USA).zip | 2026-01-02 14:40 | 354K | |
![[ ]](/icons/compressed.gif) | Chiki Chiki Boys (USA, Europe).zip | 2026-01-02 14:40 | 493K | |
![[ ]](/icons/compressed.gif) | Chi Chi's Pro Challenge Golf (USA).zip | 2026-01-02 14:40 | 232K | |
![[ ]](/icons/compressed.gif) | Chester Cheetah - Wild Wild Quest (USA).zip | 2026-01-02 14:40 | 419K | |
![[ ]](/icons/compressed.gif) | Chester Cheetah - Too Cool to Fool (USA).zip | 2026-01-02 14:40 | 612K | |
![[ ]](/icons/compressed.gif) | Chase H.Q. II (USA).zip | 2026-01-02 14:40 | 223K | |
![[ ]](/icons/compressed.gif) | Championship Pro-Am (USA).zip | 2026-01-02 14:40 | 100K | |
![[ ]](/icons/compressed.gif) | Championship Pool (USA).zip | 2026-01-02 14:40 | 215K | |
![[ ]](/icons/compressed.gif) | Championship Bowling (USA).zip | 2026-01-02 14:40 | 177K | |
![[ ]](/icons/compressed.gif) | Champions World Class Soccer (World) (En,Fr,De,Es).zip | 2026-01-02 14:40 | 501K | |
![[ ]](/icons/compressed.gif) | Champions World Class Soccer (World) (Beta) (1994-03-18).zip | 2026-01-02 14:40 | 500K | |
![[ ]](/icons/compressed.gif) | Chakan (USA, Europe).zip | 2026-01-02 14:40 | 656K | |
![[ ]](/icons/compressed.gif) | Chakan (USA, Europe) (1992-10-06) (Sega Channel).zip | 2026-01-02 14:40 | 656K | |
![[ ]](/icons/compressed.gif) | Centurion - Defender of Rome (USA, Europe).zip | 2026-01-02 14:40 | 489K | |
![[ ]](/icons/compressed.gif) | Centurion - Defender of Rome (USA, Europe) (Sega Channel).zip | 2026-01-02 14:40 | 501K | |
![[ ]](/icons/compressed.gif) | CDX Pro (World) (v1.70) (Program) (Unl) [b].zip | 2026-01-02 14:40 | 44K | |
![[ ]](/icons/compressed.gif) | CDX Pro (World) (v1.8I) (Program) (Unl).zip | 2026-01-02 14:40 | 6.3K | |
![[ ]](/icons/compressed.gif) | Castlevania - Bloodlines (USA).zip | 2026-01-02 14:40 | 691K | |
![[ ]](/icons/compressed.gif) | Castlevania - Bloodlines (USA) (Castlevania Anniversary Collection).zip | 2026-01-02 14:40 | 695K | |
![[ ]](/icons/compressed.gif) | Castlevania - Bloodlines (USA) (Beta) (1993-08-04).zip | 2026-01-02 14:40 | 440K | |
![[ ]](/icons/compressed.gif) | Castle of Illusion Starring Mickey Mouse (USA, Europe).zip | 2026-01-02 14:40 | 389K | |
![[ ]](/icons/compressed.gif) | Cascade (World) (Unl).zip | 2026-01-02 14:40 | 251K | |
![[ ]](/icons/compressed.gif) | Captain America and the Avengers (USA).zip | 2026-01-02 14:40 | 635K | |
![[ ]](/icons/compressed.gif) | Captain America and the Avengers (USA) (Beta).zip | 2026-01-02 14:40 | 615K | |
![[ ]](/icons/compressed.gif) | California Games (USA, Europe).zip | 2026-01-02 14:40 | 326K | |
![[ ]](/icons/compressed.gif) | Caliber.50 (USA).zip | 2026-01-02 14:40 | 265K | |
![[ ]](/icons/compressed.gif) | Cal Ripken Jr. Baseball (USA).zip | 2026-01-02 14:40 | 423K | |
![[ ]](/icons/compressed.gif) | Caesars Palace (USA).zip | 2026-01-02 14:40 | 280K | |
![[ ]](/icons/compressed.gif) | Cadash (USA, Korea).zip | 2026-01-02 14:40 | 330K | |
![[ ]](/icons/compressed.gif) | Burning Force (USA).zip | 2026-01-02 14:40 | 255K | |
![[ ]](/icons/compressed.gif) | Bulls vs Lakers and the NBA Playoffs (USA, Europe).zip | 2026-01-02 14:40 | 453K | |
![[ ]](/icons/compressed.gif) | Bulls versus Blazers and the NBA Playoffs (USA, Europe).zip | 2026-01-02 14:40 | 470K | |
![[ ]](/icons/compressed.gif) | Bugs Bunny in Double Trouble (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Budokan - The Martial Spirit (USA) (Unl).zip | 2026-01-02 14:40 | 351K | |
![[ ]](/icons/compressed.gif) | Budokan - The Martial Spirit (USA) (Rev 1) (Beta) (1990-09-25).zip | 2026-01-02 14:40 | 352K | |
![[ ]](/icons/compressed.gif) | Buck Rogers - Countdown to Doomsday (USA, Europe).zip | 2026-01-02 14:40 | 863K | |
![[ ]](/icons/compressed.gif) | Bubsy in - Claws Encounters of the Furred Kind (USA, Europe).zip | 2026-01-02 14:40 | 929K | |
![[ ]](/icons/compressed.gif) | Bubsy II (USA, Europe).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | Bubble and Squeak (USA).zip | 2026-01-02 14:40 | 296K | |
![[ ]](/icons/compressed.gif) | Bubba 'N' Stix (USA).zip | 2026-01-02 14:40 | 535K | |
![[ ]](/icons/compressed.gif) | Brutal - Paws of Fury (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Brian Lara Cricket 96 (U).zip | 2026-01-02 14:40 | 532K | |
![[ ]](/icons/compressed.gif) | Brian Lara Cricket (U).zip | 2026-01-02 14:40 | 450K | |
![[ ]](/icons/compressed.gif) | Brett Hull Hockey 95 (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Breach (USA) (Proto).zip | 2026-01-02 14:40 | 184K | |
![[ ]](/icons/compressed.gif) | Bram Stoker's Dracula (USA).zip | 2026-01-02 14:40 | 597K | |
![[ ]](/icons/compressed.gif) | Boxing Legends of the Ring (USA).zip | 2026-01-02 14:40 | 561K | |
![[ ]](/icons/compressed.gif) | Boogerman - A Pick and Flick Adventure (USA).zip | 2026-01-02 14:40 | 1.5M | |
![[ ]](/icons/compressed.gif) | Bonkers (USA, Europe).zip | 2026-01-02 14:40 | 574K | |
![[ ]](/icons/compressed.gif) | Bonkers (USA, Europe) (Beta) (1994-08-29).zip | 2026-01-02 14:40 | 580K | |
![[ ]](/icons/compressed.gif) | Bonkers (USA, Europe) (Beta) (1994-08-25).zip | 2026-01-02 14:40 | 571K | |
![[ ]](/icons/compressed.gif) | Bonkers (USA, Europe) (Beta) (1994-08-04).zip | 2026-01-02 14:40 | 560K | |
![[ ]](/icons/compressed.gif) | Bonkers (USA, Europe) (Beta) (1994-05-03).zip | 2026-01-02 14:40 | 538K | |
![[ ]](/icons/compressed.gif) | Bonkers (USA, Europe) (Beta) (1994-03-28).zip | 2026-01-02 14:40 | 580K | |
![[ ]](/icons/compressed.gif) | Bonanza Bros. (USA, Europe, Korea) (Rev B).zip | 2026-01-02 14:40 | 199K | |
![[ ]](/icons/compressed.gif) | Body Count (U).zip | 2026-01-02 14:40 | 388K | |
![[ ]](/icons/compressed.gif) | Blockout (World).zip | 2026-01-02 14:40 | 68K | |
![[ ]](/icons/compressed.gif) | Blockbuster World Video Game Championship II (USA).zip | 2026-01-02 14:40 | 2.1M | |
![[ ]](/icons/compressed.gif) | Blaster Master 2 (USA).zip | 2026-01-02 14:40 | 401K | |
![[ ]](/icons/compressed.gif) | Blaster Master 2 (USA) (Beta).zip | 2026-01-02 14:40 | 401K | |
![[ ]](/icons/compressed.gif) | Blades of Vengeance (USA, Europe).zip | 2026-01-02 14:40 | 567K | |
![[ ]](/icons/compressed.gif) | Bio Hazard Battle (USA, Europe).zip | 2026-01-02 14:40 | 569K | |
![[ ]](/icons/compressed.gif) | Bio Hazard Battle (USA, Europe) (Beta) (August, 1992).zip | 2026-01-02 14:40 | 569K | |
![[ ]](/icons/compressed.gif) | Bimini Run (USA).zip | 2026-01-02 14:40 | 304K | |
![[ ]](/icons/compressed.gif) | Bill's Tomato Game (USA) (Proto).zip | 2026-01-02 14:40 | 437K | |
![[ ]](/icons/compressed.gif) | Bill Walsh College Football 95 (USA).zip | 2026-01-02 14:40 | 896K | |
![[ ]](/icons/compressed.gif) | Bill Walsh College Football (USA, Europe).zip | 2026-01-02 14:40 | 548K | |
![[ ]](/icons/compressed.gif) | Bible Adventures (USA) (Unl).zip | 2026-01-02 14:40 | 110K | |
![[ ]](/icons/compressed.gif) | Beyond Zero Tolerance (USA) (Proto).zip | 2026-01-02 14:40 | 634K | |
![[ ]](/icons/compressed.gif) | Beyond Oasis (USA).zip | 2026-01-02 14:40 | 1.7M | |
![[ ]](/icons/compressed.gif) | Beyond Oasis (USA) (Beta) (1994-11-01).zip | 2026-01-02 14:40 | 1.7M | |
![[ ]](/icons/compressed.gif) | Best of the Best - Championship Karate (USA).zip | 2026-01-02 14:40 | 487K | |
![[ ]](/icons/unknown.gif) | BERZERK.ZIP | 2026-01-02 14:40 | 138K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA).zip | 2026-01-02 14:40 | 571K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-08-08).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-08-05).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-08-03).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-08-02).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-08-01).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-07-20).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-07-16).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-07-09).zip | 2026-01-02 14:40 | 573K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-06-10).zip | 2026-01-02 14:40 | 568K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-06-02).zip | 2026-01-02 14:40 | 567K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-30).zip | 2026-01-02 14:40 | 566K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-26).zip | 2026-01-02 14:40 | 566K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-23).zip | 2026-01-02 14:40 | 564K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-19).zip | 2026-01-02 14:40 | 564K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-17).zip | 2026-01-02 14:40 | 563K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-11).zip | 2026-01-02 14:40 | 562K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-05-06).zip | 2026-01-02 14:40 | 548K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-04-29).zip | 2026-01-02 14:40 | 545K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-04-28).zip | 2026-01-02 14:40 | 546K | |
![[ ]](/icons/compressed.gif) | Berenstain Bears' Camping Adventure, The (USA) (Beta) (1994-03-23).zip | 2026-01-02 14:40 | 484K | |
![[ ]](/icons/compressed.gif) | Beggar Prince (World) (Unl).zip | 2026-01-02 14:40 | 2.0M | |
![[ ]](/icons/compressed.gif) | Beggar Prince (World) (Rev 1) (Unl).zip | 2026-01-02 14:40 | 2.0M | |
![[ ]](/icons/compressed.gif) | Beavis and Butt-Head (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Beavis and Butt-Head (USA) (Beta).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Beauty and the Beast - Roar of the Beast (USA).zip | 2026-01-02 14:40 | 581K | |
![[ ]](/icons/compressed.gif) | Beauty and the Beast - Belle's Quest (USA).zip | 2026-01-02 14:40 | 613K | |
![[ ]](/icons/compressed.gif) | Beast Wrestler (USA).zip | 2026-01-02 14:40 | 670K | |
![[ ]](/icons/compressed.gif) | Battletoads-Double Dragon (USA).zip | 2026-01-02 14:40 | 460K | |
![[ ]](/icons/compressed.gif) | Battletoads (World).zip | 2026-01-02 14:40 | 351K | |
![[ ]](/icons/compressed.gif) | BattleTech - A Game of Armored Combat (USA).zip | 2026-01-02 14:40 | 805K | |
![[ ]](/icons/compressed.gif) | Battlemaster (USA).zip | 2026-01-02 14:40 | 376K | |
![[ ]](/icons/compressed.gif) | Battle Squadron (USA, Europe).zip | 2026-01-02 14:40 | 255K | |
![[ ]](/icons/compressed.gif) | Battle Squadron (USA, Europe) (1991-01-18) (Sega Channel).zip | 2026-01-02 14:40 | 255K | |
![[ ]](/icons/compressed.gif) | Battle Frenzy (U).zip | 2026-01-02 14:40 | 503K | |
![[ ]](/icons/compressed.gif) | Batman Returns (World).zip | 2026-01-02 14:40 | 625K | |
![[ ]](/icons/compressed.gif) | Batman Forever (World).zip | 2026-01-02 14:40 | 2.0M | |
![[ ]](/icons/compressed.gif) | Batman - The Video Game (USA).zip | 2026-01-02 14:40 | 297K | |
![[ ]](/icons/compressed.gif) | Batman - Revenge of the Joker (USA).zip | 2026-01-02 14:40 | 602K | |
![[ ]](/icons/compressed.gif) | Bass Masters Classic (USA).zip | 2026-01-02 14:40 | 708K | |
![[ ]](/icons/compressed.gif) | Bass Masters Classic - Pro Edition (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Barney's Hide & Seek Game (USA).zip | 2026-01-02 14:40 | 570K | |
![[ ]](/icons/compressed.gif) | Barney's Hide & Seek Game (USA) (Beta) (1993-09-18).zip | 2026-01-02 14:40 | 570K | |
![[ ]](/icons/compressed.gif) | Barkley Shut Up and Jam! (USA, Europe).zip | 2026-01-02 14:40 | 551K | |
![[ ]](/icons/compressed.gif) | Barkley Shut Up and Jam 2 (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Barkley Shut Up and Jam 2 (USA) (Beta).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Bare Knuckle - Ikari no Tekken ~ Streets of Rage (World).zip | 2026-01-02 14:40 | 362K | |
![[ ]](/icons/compressed.gif) | Bare Knuckle - Ikari no Tekken ~ Streets of Rage (World) (Rev A).zip | 2026-01-02 14:40 | 362K | |
![[ ]](/icons/compressed.gif) | Barbie Vacation Adventure (USA) (Proto).zip | 2026-01-02 14:40 | 509K | |
![[ ]](/icons/compressed.gif) | Barbie Super Model (USA).zip | 2026-01-02 14:40 | 372K | |
![[ ]](/icons/compressed.gif) | Barbie Super Model (USA) (Beta) (1993-06-30).zip | 2026-01-02 14:40 | 322K | |
![[ ]](/icons/compressed.gif) | Ballz 3D - Fighting at Its Ballziest ~ Ballz 3D - The Battle of the Ballz (USA, Europe).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | Ballz 3D - Fighting at Its Ballziest ~ Ballz 3D - The Battle of the Ballz (USA, Europe) (Beta 2).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | Ballz 3D - Fighting at Its Ballziest ~ Ballz 3D - The Battle of the Ballz (USA, Europe) (Beta 1).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Ball Jacks (W).zip | 2026-01-02 14:40 | 152K | |
![[ ]](/icons/compressed.gif) | Back to the Future Part III (USA).zip | 2026-01-02 14:40 | 197K | |
![[ ]](/icons/compressed.gif) | Baby's Day Out (USA) (Proto 2).zip | 2026-01-02 14:40 | 551K | |
![[ ]](/icons/compressed.gif) | Baby's Day Out (USA) (Proto 1).zip | 2026-01-02 14:40 | 426K | |
![[ ]](/icons/compressed.gif) | Baby Boom (USA) (Proto) (1994-08-11).zip | 2026-01-02 14:40 | 613K | |
![[ ]](/icons/compressed.gif) | Baby Boom (USA) (Proto) (1994-06-06).zip | 2026-01-02 14:40 | 241K | |
![[ ]](/icons/compressed.gif) | Baby Boom (USA) (Proto) (1994-06-03).zip | 2026-01-02 14:40 | 240K | |
![[ ]](/icons/compressed.gif) | B.O.B. (USA, Europe) (Rev A).zip | 2026-01-02 14:40 | 627K | |
![[ ]](/icons/compressed.gif) | B.O.B. (USA, Europe) (Beta).zip | 2026-01-02 14:40 | 615K | |
![[ ]](/icons/compressed.gif) | Ayrton Senna's Super Monaco GP II (USA) (En,Ja).zip | 2026-01-02 14:40 | 744K | |
![[ ]](/icons/compressed.gif) | Awesome Possum... ...Kicks Dr. Machino's Butt (USA).zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | Awesome Possum Kicks Dr Machino's Butt! (USA) (Beta 2).zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | Awesome Possum Kicks Dr Machino's Butt! (USA) (Beta 1) [b].zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | Australian Rugby League (U).zip | 2026-01-02 14:40 | 663K | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-09-08).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-08-08).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-08-05).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-08-02).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-07-23).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-07-19).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | ATP Tour Championship Tennis (USA) (Beta) (1994-05-09).zip | 2026-01-02 14:40 | 937K | |
![[ ]](/icons/compressed.gif) | Atomic Runner (USA).zip | 2026-01-02 14:40 | 513K | |
![[ ]](/icons/compressed.gif) | Atomic Robo-Kid (USA).zip | 2026-01-02 14:40 | 194K | |
![[ ]](/icons/compressed.gif) | Asterix and the Power of the Gods (U).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Asterix and the Great Rescue (USA).zip | 2026-01-02 14:40 | 970K | |
![[ ]](/icons/compressed.gif) | Art of Fighting (USA).zip | 2026-01-02 14:40 | 931K | |
![[ ]](/icons/compressed.gif) | Art of Fighting (USA) (Beta) (1994-07-11).zip | 2026-01-02 14:40 | 924K | |
![[ ]](/icons/compressed.gif) | Art Alive (World).zip | 2026-01-02 14:40 | 57K | |
![[ ]](/icons/compressed.gif) | Art Alive (World) (Beta) (1991-09-20).zip | 2026-01-02 14:40 | 58K | |
![[ ]](/icons/compressed.gif) | Arrow Flash (USA).zip | 2026-01-02 14:40 | 252K | |
![[ ]](/icons/compressed.gif) | Arnold Palmer Tournament Golf (USA, Europe).zip | 2026-01-02 14:40 | 290K | |
![[ ]](/icons/compressed.gif) | Arnold Palmer Tournament Golf (USA, Europe) (Rev A) (Beta) (1990-03-22) (Sega Channel).zip | 2026-01-02 14:40 | 291K | |
![[ ]](/icons/compressed.gif) | Ariel the Little Mermaid (USA, Europe).zip | 2026-01-02 14:40 | 301K | |
![[ ]](/icons/compressed.gif) | Ariel the Little Mermaid (USA, Europe) (1992-10-10) (Sega Channel).zip | 2026-01-02 14:40 | 301K | |
![[ ]](/icons/compressed.gif) | Arcus Odyssey (USA).zip | 2026-01-02 14:40 | 785K | |
![[ ]](/icons/compressed.gif) | Arch Rivals - The Arcade Game (USA, Europe).zip | 2026-01-02 14:40 | 197K | |
![[ ]](/icons/compressed.gif) | Arcade Legends Street Fighter II' - Special Champion Edition ~ Mega Drive Play TV 3 (World).zip | 2026-01-02 14:40 | 2.0M | |
![[ ]](/icons/compressed.gif) | Arcade Legends Sega Mega Drive ~ Arcade Legends Sega Genesis ~ Mega Drive Play TV (World).zip | 2026-01-02 14:40 | 2.3M | |
![[ ]](/icons/compressed.gif) | Arcade Classics (USA, Europe).zip | 2026-01-02 14:40 | 101K | |
![[ ]](/icons/compressed.gif) | Aquatic Games Starring James Pond and the Aquabats, The (USA, Europe).zip | 2026-01-02 14:40 | 200K | |
![[ ]](/icons/compressed.gif) | Animaniacs (USA).zip | 2026-01-02 14:40 | 618K | |
![[ ]](/icons/compressed.gif) | Andre Agassi Tennis (USA).zip | 2026-01-02 14:40 | 329K | |
![[ ]](/icons/compressed.gif) | Andre Agassi Tennis (USA) (Beta) (August, 1992).zip | 2026-01-02 14:40 | 328K | |
![[ ]](/icons/compressed.gif) | American Gladiators (USA).zip | 2026-01-02 14:40 | 413K | |
![[ ]](/icons/compressed.gif) | Altered Beast (USA, Europe).zip | 2026-01-02 14:40 | 318K | |
![[ ]](/icons/compressed.gif) | Alisia Dragoon (USA).zip | 2026-01-02 14:40 | 595K | |
![[ ]](/icons/compressed.gif) | Alien Storm (World).zip | 2026-01-02 14:40 | 362K | |
![[ ]](/icons/compressed.gif) | Alien Soldier (USA) (Virtual Console).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Alien 3 (USA, Europe).zip | 2026-01-02 14:40 | 310K | |
![[ ]](/icons/compressed.gif) | Alien 3 (USA, Europe) (Rev A).zip | 2026-01-02 14:40 | 311K | |
![[ ]](/icons/compressed.gif) | Alex Kidd in the Enchanted Castle (USA).zip | 2026-01-02 14:40 | 150K | |
![[ ]](/icons/compressed.gif) | Aladdin (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Aladdin (USA) (Final Cut).zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | Aladdin (USA) (Beta) (August, 1993).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Aladdin (USA) (Beta) (1993-06-27) (Chicago C.E.S. Demo).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Al Michaels Announces HardBall III (USA, Europe).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | Akira (USA) (Proto).zip | 2026-01-02 14:40 | 1.3M | |
![[ ]](/icons/compressed.gif) | Air Diver (USA).zip | 2026-01-02 14:40 | 271K | |
![[ ]](/icons/compressed.gif) | Air Buster (USA).zip | 2026-01-02 14:40 | 313K | |
![[ ]](/icons/compressed.gif) | After Burner II (USA, Europe).zip | 2026-01-02 14:40 | 240K | |
![[ ]](/icons/compressed.gif) | Aerobiz Supersonic (USA).zip | 2026-01-02 14:40 | 464K | |
![[ ]](/icons/compressed.gif) | Aerobiz (USA).zip | 2026-01-02 14:40 | 412K | |
![[ ]](/icons/compressed.gif) | Aero the Acro-Bat 2 (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Aero the Acro-Bat (USA).zip | 2026-01-02 14:40 | 507K | |
![[ ]](/icons/compressed.gif) | Adventures of Rocky and Bullwinkle and Friends, The (USA).zip | 2026-01-02 14:40 | 547K | |
![[ ]](/icons/compressed.gif) | Adventures of Mighty Max, The (USA).zip | 2026-01-02 14:40 | 542K | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-28).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-27).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-26).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-24).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-22).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-21).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-19).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-18).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-11).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-10).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Adventures of Batman & Robin, The (USA) (Beta) (1995-04-06).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | Addams Family, The (USA, Europe).zip | 2026-01-02 14:40 | 601K | |
![[ ]](/icons/compressed.gif) | Addams Family, The (USA, Europe) (Beta).zip | 2026-01-02 14:40 | 601K | |
![[ ]](/icons/compressed.gif) | Action 52 (USA) (Unl).zip | 2026-01-02 14:40 | 549K | |
![[ ]](/icons/compressed.gif) | Aaahh!!! Real Monsters (USA).zip | 2026-01-02 14:40 | 931K | |
![[ ]](/icons/compressed.gif) | Aaahh!!! Real Monsters (USA) (Beta) (1995-07-07).zip | 2026-01-02 14:40 | 932K | |
![[ ]](/icons/compressed.gif) | 688 Attack Sub (USA, Europe).zip | 2026-01-02 14:40 | 609K | |
![[ ]](/icons/compressed.gif) | 6-Pak (USA).zip | 2026-01-02 14:40 | 1.8M | |
![[ ]](/icons/compressed.gif) | 3 Ninjas Kick Back (USA).zip | 2026-01-02 14:40 | 897K | |
![[ ]](/icons/compressed.gif) | [BIOS] X'Eye (USA).zip | 2026-01-02 14:40 | 86K | |
![[ ]](/icons/compressed.gif) | [BIOS] Sega Mega Drive - Genesis Boot ROM (World).zip | 2026-01-02 14:40 | 930 | |
![[ ]](/icons/compressed.gif) | [BIOS] Sega CDX (USA).zip | 2026-01-02 14:40 | 92K | |
![[ ]](/icons/compressed.gif) | [BIOS] Sega CD 2A (USA).zip | 2026-01-02 14:40 | 92K | |
![[ ]](/icons/compressed.gif) | [BIOS] Sega CD 2 (USA).zip | 2026-01-02 14:40 | 91K | |
![[ ]](/icons/compressed.gif) | [BIOS] Sega CD 2 (USA) (Rev A).zip | 2026-01-02 14:40 | 91K | |
![[ ]](/icons/compressed.gif) | [BIOS] Sega CD (USA) (v1.00).zip | 2026-01-02 14:40 | 91K | |
![[DIR]](/icons/folder.gif) | Sega Genesis Extras/ | 2026-01-02 14:40 | - | |
![[DIR]](/icons/folder.gif) | Rare Games/ | 2026-01-02 14:40 | - | |
![[DIR]](/icons/folder.gif) | [Translations]/ | 2026-01-02 14:40 | - | |
![[DIR]](/icons/folder.gif) | [Prototypes]/ | 2026-01-02 14:40 | - | |
![[ ]](/icons/compressed.gif) | Zoop (USA).zip | 2026-01-02 14:40 | 102K | |
![[ ]](/icons/compressed.gif) | Zoom! (World).zip | 2026-01-02 14:40 | 154K | |
![[ ]](/icons/compressed.gif) | Zool - Ninja of the 'Nth' Dimension (USA).zip | 2026-01-02 14:40 | 522K | |
![[ ]](/icons/compressed.gif) | Zombies Ate My Neighbors (USA).zip | 2026-01-02 14:40 | 524K | |
![[ ]](/icons/compressed.gif) | Zombie High (USA) (Proto) (1992-08-11).zip | 2026-01-02 14:40 | 392K | |
![[ ]](/icons/compressed.gif) | Zero Wing (U).zip | 2026-01-02 14:40 | 359K | |
![[ ]](/icons/compressed.gif) | Zero Tolerance (USA, Europe) (Rev A).zip | 2026-01-02 14:40 | 721K | |
![[ ]](/icons/compressed.gif) | Zero the Kamikaze Squirrel (USA).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | Zany Golf (USA, Europe).zip | 2026-01-02 14:40 | 307K | |
![[ ]](/icons/compressed.gif) | Zany Golf (USA) (Unl).zip | 2026-01-02 14:40 | 307K | |
![[ ]](/icons/compressed.gif) | Yuu Yuu Hakusho - Sunset Fighters (JU).zip | 2026-01-02 14:40 | 1.2M | |
![[ ]](/icons/compressed.gif) | Ys III (USA).zip | 2026-01-02 14:40 | 709K | |
![[ ]](/icons/compressed.gif) | Ys III (USA) (Beta) (1991-08-28).zip | 2026-01-02 14:40 | 709K | |
![[ ]](/icons/compressed.gif) | Young Indiana Jones Chronicles, The (USA) (Beta).zip | 2026-01-02 14:40 | 177K | |
![[ ]](/icons/compressed.gif) | X-Perts (USA).zip | 2026-01-02 14:40 | 2.4M | |
![[ ]](/icons/compressed.gif) | X-Perts (USA) (Beta) (June, 1995).zip | 2026-01-02 14:40 | 2.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-16).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-15).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-14).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-11).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-11) (Alt 1).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-10).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-09).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-08).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-07).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-06).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-03).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-12-02).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-11-30).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-11-28).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-11-23).zip | 2026-01-02 14:40 | 1.1M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-11-17).zip | 2026-01-02 14:40 | 1.0M | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-10-18).zip | 2026-01-02 14:40 | 846K | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-05-10).zip | 2026-01-02 14:40 | 749K | |
![[ ]](/icons/compressed.gif) | X-Men 2 - Clone Wars (USA, Europe) (Beta) (1994-05-06).zip | 2026-01-02 14:40 | 747K | |
![[ ]](/icons/compressed.gif) | X-Men (USA).zip | 2026-01-02 14:40 | 727K | |
![[ ]](/icons/compressed.gif) | Xenon 2 - Megablast (U).zip | 2026-01-02 14:40 | 255K | |
![[ ]](/icons/compressed.gif) | Xeno Crisis (World) (En,Ja,Fr,De,Es,It,Nl,Pt) (Unl).zip | 2026-01-02 14:40 | 1.9M | |
![[ ]](/icons/compressed.gif) | WWF WrestleMania - The Arcade Game (USA, Europe).zip | 2026-01-02 14:40 | 3.1M | |
|